4-Hydroxy-1-methoxycarbonyl-beta-carboline

Catalog Number	ACM74690725
CAS Number	74690-72-5
Synonyms	4-Hydroxy-9h-pyrido[3,4-b]indole-1-carboxylic acid methyl ester
Molecular Weight	242.23
InChI	InChI=1S/C13H10N2O3/c1-18-13(17)12-11-10(9(16)6-14-12)7-4-2-3-5-8(7)15-11/h2-6,15-16H,1H3
InChI Key	SRJGEVLILAHFEY-UHFFFAOYSA-N
Purity	95%+
Complexity	336
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	242.06914219
Heavy Atom Count	18
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	2
Monoisotopic Mass	242.06914219
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	75.2 Ų

Custom Q&A

What are the potential uses of 4-HYDROXY-9H-PYRIDO[3,4-B]INDOLE-1-CARBOXYLIC ACID METHYL ESTER?

The compound may have uses in research, pharmaceuticals, or chemical synthesis.

What are the synonyms for the compound with CAS number 74690-72-5?

The synonyms are 4-hydroxy-1-methoxycarbonyl-beta-carboline and 9H-Pyrido[3,4-b]indole-1-carboxylic acid, 4-hydroxy-, methyl ester.

What is the molecular formula of the compound?

The molecular formula is C13H10N2O3.

What is the molecular weight of the compound?

The molecular weight is 242.23 g/mol.

What is the predicted boiling point of the compound?

The predicted boiling point is 599.1±45.0 °C.

What is the predicted density of the compound?

The predicted density is 1.463±0.06 g/cm3.

What is the predicted pKa value of the compound?

The predicted pKa value is 3.96±0.30.

※ Please kindly note that our products are for research use only.