4-Hydroxy-N-(2-hydroxyethyl)benzamide

Catalog Number	ACM75268143
CAS Number	75268-14-3
Synonyms	Bryonamide A
Molecular Weight	181.19
InChI	InChI=1S/C9H11NO3/c11-6-5-10-9(13)7-1-3-8(12)4-2-7/h1-4,11-12H,5-6H2,(H,10,13)
InChI Key	KSTDBMBMMLISJA-UHFFFAOYSA-N
Purity	95%+
Complexity	164
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	181.07389321
Heavy Atom Count	13
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	3
Monoisotopic Mass	181.07389321
PhysicalState	Oil
Rotatable Bond Count	3
Topological Polar Surface Area	69.6 Ų

Custom Q&A

What is the chemical name of the compound with the CAS number 75268-14-3?

The chemical name of the compound is 4-hydroxy-N-(2-hydroxyethyl)benzamide.

What are the synonyms for 4-hydroxy-N-(2-hydroxyethyl)benzamide?

The synonyms are Bryonamide A and Benzamide, 4-hydroxy-N-(2-hydroxyethyl)-.

What is the molecular formula of 4-hydroxy-N-(2-hydroxyethyl)benzamide?

The molecular formula is C9H11NO3.

What is the molar mass of 4-hydroxy-N-(2-hydroxyethyl)benzamide?

The molar mass is 181.19 g/mol.

What is the CAS number of 4-hydroxy-N-(2-hydroxyethyl)benzamide?

The CAS number is 75268-14-3.

What is the abbreviation for 4-hydroxy-N-(2-hydroxyethyl)benzamide?

The abbreviation is NHEB.

What is the role of 4-hydroxy-N-(2-hydroxyethyl)benzamide in biological systems?

This compound is known to have antioxidant and anti-inflammatory properties.

How is 4-hydroxy-N-(2-hydroxyethyl)benzamide usually synthesized?

It can be synthesized through various chemical reactions involving aromatic compounds and ethylene glycol.

In what industries or research fields is 4-hydroxy-N-(2-hydroxyethyl)benzamide commonly used?

This compound is often used in pharmaceutical research, cosmetic formulations, and in the production of antioxidants.

※ Please kindly note that our products are for research use only.