4-Methoxy-1-methylquinolin-2-one

Catalog Number	ACM32262183
CAS Number	32262-18-3
Structure
Synonyms	4-Methoxy-N-Methyl-2-quinolone
Molecular Weight	189.21
InChI	InChI=1S/C11H11NO2/c1-12-9-6-4-3-5-8(9)10(14-2)7-11(12)13/h3-7H,1-2H3
InChI Key	SPBLFONLHXBBQE-UHFFFAOYSA-N
Purity	95%+
Complexity	273
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	189.078978594
Heavy Atom Count	14
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	0
Monoisotopic Mass	189.078978594
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	29.5 Ų

Custom Q&A

What is the systematic name of 4-Methoxy-1-methylquinolin-2-one?

The systematic name of the compound is 4-Methoxy-1-Methyl-2(1H)-quinolinone.

What are some synonyms for the chemical compound 4-Methoxy-1-Methyl-2(1H)-quinolinone?

Some synonyms include N-Methyl-4-methoxycarbostyril and 4-Methoxy-N-Methyl-2-quinolone.

What is the molecular formula of 4-Methoxy-1-Methyl-2(1H)-quinolinone?

The molecular formula is C11H11NO2.

What is the molar mass of 4-Methoxy-1-Methyl-2(1H)-quinolinone?

The molar mass is 189.21 g/mol.

What is the chemical structure of 4-Methoxy-1-Methyl-2(1H)-quinolinone?

The chemical structure is a quinolinone ring with a methoxy and methyl group attached.

What is the significance of the methoxy and methyl groups in the chemical structure of 4-Methoxy-1-Methyl-2(1H)-quinolinone?

These groups affect the physical and chemical properties of the compound, such as solubility, reactivity, and stability.

How is 4-Methoxy-1-Methyl-2(1H)-quinolinone commonly used in research or industry?

It may be used as a building block in organic synthesis or as a precursor in the production of pharmaceuticals or other compounds.

Are there any known hazards or risks associated with working with 4-Methoxy-1-Methyl-2(1H)-quinolinone?

It is important to follow proper safety protocols when handling any chemical compound, including wearing appropriate protective equipment and conducting reactions in a well-ventilated area.

Where can one purchase 4-Methoxy-1-Methyl-2(1H)-quinolinone for research or industrial use?

It can potentially be purchased from chemical suppliers or distributors that specialize in providing research chemicals.

※ Please kindly note that our products are for research use only.