4-Methyl-5,6,7,8-tetrahydroquinoline

Catalog Number	ACM28971031
CAS Number	28971-03-1
Structure
Synonyms	Quinoline,5,6,7,8-tetrahydro-4-methyl
Molecular Weight	147.22
InChI	InChI=1S/C10H13N/c1-8-6-7-11-10-5-3-2-4-9(8)10/h6-7H,2-5H2,1H3
InChI Key	LGYCOYCCCKHXGC-UHFFFAOYSA-N
Purity	95%+
Complexity	133
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	147.104799419
Heavy Atom Count	11
Hydrogen Bond Acceptor Count	1
Hydrogen Bond Donor Count	0
Monoisotopic Mass	147.104799419
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	12.9 Ų

Custom Q&A

What is the chemical name for 4-Methyl-5,6,7,8-tetrahydroquinoline?

The chemical name for 4-Methyl-5,6,7,8-tetrahydroquinoline is 4-Methyl-5,6,7,8-tetrahydroquinoline.

What are some synonyms for 4-Methyl-5,6,7,8-tetrahydroquinoline?

Some synonyms for 4-Methyl-5,6,7,8-tetrahydroquinoline are 5,6,7,8-tetrahydro-4-methylQuinoline, 5,6,7,8-tetrahydro-4-methyl-Quinoline Diacetate, and Quinoline, 5,6,7,8-tetrahydro-4-methyl-.

What is the CAS number for 4-Methyl-5,6,7,8-tetrahydroquinoline?

The CAS number for 4-Methyl-5,6,7,8-tetrahydroquinoline is 28971-03-1.

What is the molecular formula for 4-Methyl-5,6,7,8-tetrahydroquinoline?

The molecular formula for 4-Methyl-5,6,7,8-tetrahydroquinoline is C10H13N.

What is the molecular weight of 4-Methyl-5,6,7,8-tetrahydroquinoline?

The molecular weight of 4-Methyl-5,6,7,8-tetrahydroquinoline is 147.22.

What is the structure of 4-Methyl-5,6,7,8-tetrahydroquinoline?

The structure of 4-Methyl-5,6,7,8-tetrahydroquinoline is a quinoline ring with a methyl group at the 4-position, and four hydrogen atoms at the 5, 6, 7, and 8 positions.

What are some possible applications of 4-Methyl-5,6,7,8-tetrahydroquinoline?

4-Methyl-5,6,7,8-tetrahydroquinoline is commonly used in organic synthesis and pharmaceutical research due to its unique structure and properties.

How is 4-Methyl-5,6,7,8-tetrahydroquinoline typically synthesized?

4-Methyl-5,6,7,8-tetrahydroquinoline can be synthesized through various methods, including cyclization reactions of appropriate precursors or through condensation reactions.

Are there any known biological activities or pharmacological effects associated with 4-Methyl-5,6,7,8-tetrahydroquinoline?

Yes, 4-Methyl-5,6,7,8-tetrahydroquinoline has been studied for its potential biological activities and pharmacological effects, including anticancer and anti-inflammatory properties.

※ Please kindly note that our products are for research use only.