5'-Deoxy-5'-methylthioadenosine

5'-Deoxy-5'-methylthioadenosine

Inquiry
Catalog Number ACM2457809-1
CAS Number 2457-80-9
Structure
Synonyms 7-(5-Methylthio-5-deoxy-D-ribofuranosyl)-7H-purine-6-amine
Molecular Weight 297.34
InChI InChI=1S/C11H15N5O3S/c1-20-2-5-7(17)8(18)11(19-5)16-4-15-6-9(12)13-3-14-10(6)16/h3-5,7-8,11,17-18H,2H2,1H3,(H2,12,13,14)/t5-,7-,8-,11-/m1/s1
InChI Key WUUGFSXJNOTRMR-IOSLPCCCSA-N
Melting Point 210-213 °C
Purity 95%+
Complexity 352
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 4
Exact Mass 297.08956053
Heavy Atom Count 20
Hydrogen Bond Acceptor Count 8
Hydrogen Bond Donor Count 3
Isomeric SMILES CSC[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=NC3=C(N=CN=C32)N)O)O
Monoisotopic Mass 297.08956053
PhysicalState Powder
Rotatable Bond Count 3
Topological Polar Surface Area 145 Ų
Custom Q&A

What is the product name of the chemical compound with the synonym 5'-Deoxy-5'-methylthioadenosine?

5'-DEOXY-5'-METHYLTHIOADENOSINE

What is the molecular formula of 5'-Deoxy-5'-methylthioadenosine?

C11H15N5O3S

What is the molecular weight of 5'-Deoxy-5'-methylthioadenosine?

297.33

What is the boiling point of 5'-Deoxy-5'-methylthioadenosine?

642.7±65.0 °C

How is 5'-Deoxy-5'-methylthioadenosine stored?

At -20°C

What is the safety statement associated with 5'-Deoxy-5'-methylthioadenosine?

Safety Statements 22-24/25

How is 5'-Deoxy-5'-methylthioadenosine used as per the reference?

It has been used as a protein methylation inhibitor to reduce E2F1 protein abundance in hepatocellular carcinoma cells and to inhibit histone methylation modification.

What is the biological activity of 5'-Deoxy-5'-methylthioadenosine?

It behaves as a powerful inhibitory product and may be used as a substrate to study the specificity and kinetics of 5'-methylthioadenosine phosphorylase.

How is 5'-Deoxy-5'-methylthioadenosine purified?

It can be recrystallized from H2O and sublime at 200o/0.004mm.

According to the reference, what cellular processes may be influenced by endogenous 5'-Deoxy-5'-methylthioadenosine?

Endogenous 5'-Deoxy-5'-methylthioadenosine might play a regulatory role in various cellular processes such as proliferation, gene expression regulation, differentiation, and apoptosis.

※ Please kindly note that our products are for research use only.