5-Epilithospermoside

Catalog Number	ACM84799315
CAS Number	84799-31-5
Molecular Weight	329.3
InChI	InChI=1S/C14H19NO8/c15-4-3-6-1-2-7(17)9(18)13(6)23-14-12(21)11(20)10(19)8(5-16)22-14/h1-3,7-14,16-21H,5H2
InChI Key	WIIDBJNWXCWLKF-UHFFFAOYSA-N
Melting Point	221-223 °C
Purity	95%+
Complexity	526
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	329.11106656
Heavy Atom Count	23
Hydrogen Bond Acceptor Count	9
Hydrogen Bond Donor Count	6
Monoisotopic Mass	329.11106656
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	164 Ų

Custom Q&A

What is the chemical name of the compound with the synonym 5-Epilithospermoside?

The chemical name is Acetonitrile, 2-[(4R,5R,6S)-6-(β-D-glucopyranosyloxy)-4,5-dihydroxy-2-cyclohexen-1-ylidene]-, (2Z)-

What is the CAS number for 5-Epilithospermoside?

The CAS number is 84799-31-5

What is the molecular formula of 5-Epilithospermoside?

The molecular formula is C14H19NO8

What is the molecular weight of 5-Epilithospermoside?

The molecular weight is 329.31

What is the melting point of 5-Epilithospermoside?

The melting point is 221-223 °C

What is the boiling point of 5-Epilithospermoside?

The boiling point is 662.4±55.0 °C (Predicted)

What is the density of 5-Epilithospermoside?

The density is 1.61±0.1 g/cm3 (Predicted)

What is the pka value of 5-Epilithospermoside?

The pka value is 12.71±0.60 (Predicted)

※ Please kindly note that our products are for research use only.