5-Hydroxypyrrolidin-2-one

Catalog Number	ACM62312554
CAS Number	62312-55-4
Structure
Synonyms	DL-5-Hydroxy-2-pyrrolidone
Molecular Weight	101.1
InChI	InChI=1S/C4H7NO2/c6-3-1-2-4(7)5-3/h3,6H,1-2H2,(H,5,7)
InChI Key	WBGWUCXEMSSZJL-UHFFFAOYSA-N
Melting Point	98-99 °C
Purity	95%+
Complexity	91.7
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	101.047678466
Heavy Atom Count	7
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	2
Monoisotopic Mass	101.047678466
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	49.3 Ų

Custom Q&A

What is the chemical name of the compound 5-hydroxypyrrolidin-2-one?

The chemical name of the compound is 5-hydroxypyrrolidin-2-one.

What are some synonyms for 5-hydroxypyrrolidin-2-one?

Some synonyms for 5-hydroxypyrrolidin-2-one include 5-hydroxypyrrolidin-2-one.

What is the molecular formula of 5-hydroxypyrrolidin-2-one?

The molecular formula of 5-hydroxypyrrolidin-2-one is C4H7NO2.

What is the molar mass of 5-hydroxypyrrolidin-2-one?

The molar mass of 5-hydroxypyrrolidin-2-one is 101.10388 g/mol.

What is the molecular weight of 5-hydroxypyrrolidin-2-one?

The molecular weight of 5-hydroxypyrrolidin-2-one is 101.10388 g/mol.

What are the elements present in the molecular formula of 5-hydroxypyrrolidin-2-one?

The elements present in the molecular formula are carbon, hydrogen, nitrogen, and oxygen.

How many oxygen atoms are in the molecular formula of 5-hydroxypyrrolidin-2-one?

There are two oxygen atoms in the molecular formula of 5-hydroxypyrrolidin-2-one.

How many hydrogen atoms are in the molecular formula of 5-hydroxypyrrolidin-2-one?

There are seven hydrogen atoms in the molecular formula of 5-hydroxypyrrolidin-2-one.

※ Please kindly note that our products are for research use only.