5-Methoxystrictamine

Catalog Number	ACM870995645
CAS Number	870995-64-5
Synonyms	Methyl (5alpha,16R,19E)-5-methoxyakuammilan-17-oate
Molecular Weight	352.4
InChI	InChI=1S/C21H24N2O3/c1-4-12-11-23-16-9-13(12)18(20(24)26-3)21(10-17(23)25-2)14-7-5-6-8-15(14)22-19(16)21/h4-8,13,16-18H,9-11H2,1-3H3/b12-4-/t13,16-,17-,18?,21-/m0/s1
InChI Key	FNXBCZCMPCVOPU-IMKKEMNLSA-N
Melting Point	232-235 °C
Purity	95%+
Complexity	687
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	3
Exact Mass	352.17869263
Heavy Atom Count	26
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	0
Isomeric SMILES	C/C=C\1/CN2[C@H]3CC1C([C@]4(C3=NC5=CC=CC=C54)C[C@@H]2OC)C(=O)OC
Monoisotopic Mass	352.17869263
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	51.1 Ų

Custom Q&A

What is the chemical formula of 5-Methoxystrictamine?

The chemical formula of 5-Methoxystrictamine is C21H24N2O3.

What is the molecular weight of 5-Methoxystrictamine?

The molecular weight of 5-Methoxystrictamine is 352.43.

What is the melting point of 5-Methoxystrictamine?

The melting point of 5-Methoxystrictamine is 232-235 °C.

In what form is 5-Methoxystrictamine found?

5-Methoxystrictamine is found in powder form.

What is the predicted boiling point of 5-Methoxystrictamine?

The predicted boiling point of 5-Methoxystrictamine is 479.8±45.0 °C.

What solvents is 5-Methoxystrictamine soluble in?

5-Methoxystrictamine is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What is the pka value of 5-Methoxystrictamine?

The pka value of 5-Methoxystrictamine is 5.14±0.60.

What are some synonyms for 5-Methoxystrictamine?

Some synonyms for 5-Methoxystrictamine include Methyl (5alpha,16R,19E)-5-methoxyakuammilan-17-oate and 2H-2,7a-Methanoindolo[2,3-a]quinolizine-13-carboxylic acid, 3-ethylidene-1,3,4,6,7,12b-hexahydro-6-methoxy-, methyl ester, (2R,3E,5S,6S,7aR,12bS,13R)-.

What is the CAS number for 5-Methoxystrictamine?

The CAS number for 5-Methoxystrictamine is 870995-64-5.

What is the density of 5-Methoxystrictamine?

The density of 5-Methoxystrictamine is 1.37±0.1 g/cm3.

※ Please kindly note that our products are for research use only.