6-Acetonyldihydrosanguinarine

6-Acetonyldihydrosanguinarine

Inquiry
Catalog Number ACM37687346
CAS Number 37687-34-6
Synonyms 6-Acetonyl-5,6-dihydrosanguinarine
Molecular Weight 389.4
InChI InChI=1S/C23H19NO5/c1-12(25)7-17-21-14(5-6-18-23(21)29-11-26-18)15-4-3-13-8-19-20(28-10-27-19)9-16(13)22(15)24(17)2/h3-6,8-9,17H,7,10-11H2,1-2H3
InChI Key ONEHMWWDDDSJBB-UHFFFAOYSA-N
Purity 95%+
Complexity 657
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 389.12632271
Heavy Atom Count 29
Hydrogen Bond Acceptor Count 6
Hydrogen Bond Donor Count 0
Monoisotopic Mass 389.12632271
PhysicalState Powder
Rotatable Bond Count 2
Topological Polar Surface Area 57.2 Ų
Custom Q&A

What is the usage of 6-Acetonyldihydrosanguinarine?

6-Acetonyldihydrosanguinarine is a benzophenanthridine alkaloid.

What are the synonyms of 6-Acetonyldihydrosanguinarine?

The synonyms of 6-Acetonyldihydrosanguinarine are (S)-(+)-6-Acetonyldihydrosanguinarine, 6-Acetonyl-5,6-dihydrosanguinarine, 8-Acetonyldihydrosanguinarine, and others.

What is the CAS number of 6-Acetonyldihydrosanguinarine?

The CAS number of 6-Acetonyldihydrosanguinarine is 37687-34-6.

What is the molecular formula of 6-Acetonyldihydrosanguinarine?

The molecular formula of 6-Acetonyldihydrosanguinarine is C23H19NO5.

What is the molecular weight of 6-Acetonyldihydrosanguinarine?

The molecular weight of 6-Acetonyldihydrosanguinarine is 389.4.

What is the boiling point of 6-Acetonyldihydrosanguinarine?

The boiling point of 6-Acetonyldihydrosanguinarine is 597.3±50.0 °C (Predicted).

In what solvents is 6-Acetonyldihydrosanguinarine soluble?

6-Acetonyldihydrosanguinarine is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What is the form of 6-Acetonyldihydrosanguinarine?

6-Acetonyldihydrosanguinarine is in powder form.

What is the color of 6-Acetonyldihydrosanguinarine?

The color of 6-Acetonyldihydrosanguinarine is yellow.

※ Please kindly note that our products are for research use only.