6-Ethoxydihydrosanguinarine

6-Ethoxydihydrosanguinarine

Inquiry
Catalog Number ACM28342316-1
CAS Number 28342-31-6
Structure
Synonyms 14-Ethoxy-13,14-dihydrosanguinarine
Molecular Weight 377.4
InChI InChI=1S/C22H19NO5/c1-3-24-22-19-13(6-7-16-21(19)28-11-25-16)14-5-4-12-8-17-18(27-10-26-17)9-15(12)20(14)23(22)2/h4-9,22H,3,10-11H2,1-2H3
InChI Key FCEXWTOTHXCQCQ-UHFFFAOYSA-N
Melting Point 210-212 °C
Purity 95%+
Complexity 589
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 377.12632271
Heavy Atom Count 28
Hydrogen Bond Acceptor Count 6
Hydrogen Bond Donor Count 0
Monoisotopic Mass 377.12632271
PhysicalState Powder
Rotatable Bond Count 2
Topological Polar Surface Area 49.4 Ų
Custom Q&A

What is the chemical formula of Ethoxysanguinarine?

The chemical formula of Ethoxysanguinarine is C22H19NO5.

What is the molecular weight of Ethoxysanguinarine?

The molecular weight of Ethoxysanguinarine is 377.39 g/mol.

What are some synonyms for Ethoxysanguinarine?

Some synonyms for Ethoxysanguinarine include Sanguinarine pseudoethanolate, 14-Ethoxy-13,14-dihydrosanguinarine, and 6-Ethoxydihydrosanguinarine.

What is the CAS number for Ethoxysanguinarine?

The CAS number for Ethoxysanguinarine is 28342-31-6.

What is the melting point of Ethoxysanguinarine?

The melting point of Ethoxysanguinarine is 210-212°C (ethanol).

In what solvents is Ethoxysanguinarine soluble?

Ethoxysanguinarine is soluble in DMSO.

What is the storage temperature recommendation for Ethoxysanguinarine?

The storage temperature recommendation for Ethoxysanguinarine is 4°C, and it should be protected from light.

What is the predicted boiling point of Ethoxysanguinarine?

The predicted boiling point of Ethoxysanguinarine is 563.7±50.0 °C.

What is the predicted pka value of Ethoxysanguinarine?

The predicted pka value of Ethoxysanguinarine is 0.59±0.40.

What are the product categories of Ethoxysanguinarine?

The product categories of Ethoxysanguinarine include reagent and standard substance.

※ Please kindly note that our products are for research use only.