6-Methoxydihydrosanguinarine

6-Methoxydihydrosanguinarine

Inquiry
Catalog Number ACM72401548
CAS Number 72401-54-8
Synonyms (-)-6-Methoxydihydrosanguinarine
Molecular Weight 363.4
InChI InChI=1S/C21H17NO5/c1-22-19-13(4-3-11-7-16-17(8-14(11)19)26-9-25-16)12-5-6-15-20(27-10-24-15)18(12)21(22)23-2/h3-8,21H,9-10H2,1-2H3
InChI Key MHPDDMNAUJQRSW-UHFFFAOYSA-N
Purity 95%+
Complexity 575
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 363.11067264
Heavy Atom Count 27
Hydrogen Bond Acceptor Count 6
Hydrogen Bond Donor Count 0
Monoisotopic Mass 363.11067264
PhysicalState Powder
Rotatable Bond Count 1
Topological Polar Surface Area 49.4 Ų
Custom Q&A

What is the chemical formula of 6-methoxydihydrosanguinarine?

The chemical formula of 6-methoxydihydrosanguinarine is C21H17NO5.

What is the molecular weight of 6-methoxydihydrosanguinarine?

The molecular weight of 6-methoxydihydrosanguinarine is 363.36.

What are some synonyms for 6-methoxydihydrosanguinarine?

Some synonyms for 6-methoxydihydrosanguinarine are 6-Methoxy-13,14-dihydro-13-methyl[1,3]benzodioxolo[5,6-c]-1,3-dioxolo[4,5-i]phenanthridine and 6-Methoxydihydroavicine.

In what form does 6-methoxydihydrosanguinarine exist?

6-methoxydihydrosanguinarine exists in the form of off-white crystalline powder.

What solvents is 6-methoxydihydrosanguinarine soluble in?

6-methoxydihydrosanguinarine is soluble in methanol, ethanol, DMSO, and other organic solvents.

What are some of the known uses of 6-methoxydihydrosanguinarine?

6-methoxydihydrosanguinarine has antibacterial, insecticidal, liver function improvement, immunity enhancement, and anti-tumor effects.

What is the target IC50 of 6-methoxydihydrosanguinarine?

The target IC50 of 6-methoxydihydrosanguinarine is platelet aggregation induced by AA-, collagen- and PAF.

Can 6-methoxydihydrosanguinarine be used as an insecticide?

Yes, 6-methoxydihydrosanguinarine has insecticidal effects.

How does 6-methoxydihydrosanguinarine affect platelet aggregation?

6-methoxydihydrosanguinarine inhibits platelet aggregation induced by AA-, collagen- and PAF.

What are some potential health benefits associated with the use of 6-methoxydihydrosanguinarine?

Some potential health benefits of 6-methoxydihydrosanguinarine include antibacterial properties, liver function improvement, enhanced immunity, and anti-tumor effects.

※ Please kindly note that our products are for research use only.