6-Methyl-9H-carbazol-3-ol

Catalog Number	ACM5257089
CAS Number	5257-08-9
Synonyms	Glycozolinine
Molecular Weight	197.23
InChI	InChI=1S/C13H11NO/c1-8-2-4-12-10(6-8)11-7-9(15)3-5-13(11)14-12/h2-7,14-15H,1H3
InChI Key	HGWWJXCROVKODY-UHFFFAOYSA-N
Purity	95%+
Complexity	243
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	197.084063974
Heavy Atom Count	15
Hydrogen Bond Acceptor Count	1
Hydrogen Bond Donor Count	2
Monoisotopic Mass	197.084063974
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	36 Ų

Custom Q&A

What is the chemical name of Glycozolinine?

The chemical name of Glycozolinine is 6-Methyl-9H-carbazol-3-ol.

What are some other synonyms for Glycozolinine?

Some other synonyms for Glycozolinine are 3-Methyl-6-hydroxycarbazole, Glycozolinol, and 9H-Carbazol-3-ol, 6-methyl-.

What is the CAS number for Glycozolinine?

The CAS number for Glycozolinine is 5257-08-9.

What is the molecular formula of Glycozolinine?

The molecular formula of Glycozolinine is C13H11NO.

What is the molecular weight of Glycozolinine?

The molecular weight of Glycozolinine is 197.23.

What is the boiling point of Glycozolinine?

The boiling point of Glycozolinine is predicted to be 439.0±25.0 °C.

What is the density of Glycozolinine?

The density of Glycozolinine is predicted to be 1.308±0.06 g/cm3.

What is the predicted pKa value of Glycozolinine?

The predicted pKa value of Glycozolinine is 10.07±0.30.

※ Please kindly note that our products are for research use only.