6-Methyl-9H-carbazol-3-ol

6-Methyl-9H-carbazol-3-ol

Inquiry
Catalog Number ACM5257089
CAS Number 5257-08-9
Structure
Synonyms Glycozolinine
Molecular Weight 197.23
InChI InChI=1S/C13H11NO/c1-8-2-4-12-10(6-8)11-7-9(15)3-5-13(11)14-12/h2-7,14-15H,1H3
InChI Key HGWWJXCROVKODY-UHFFFAOYSA-N
Purity 95%+
Complexity 243
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 197.084063974
Heavy Atom Count 15
Hydrogen Bond Acceptor Count 1
Hydrogen Bond Donor Count 2
Monoisotopic Mass 197.084063974
PhysicalState Powder
Rotatable Bond Count 0
Topological Polar Surface Area 36 Ų
Custom Q&A

What is the chemical name of Glycozolinine?

The chemical name of Glycozolinine is 6-Methyl-9H-carbazol-3-ol.

What are some other synonyms for Glycozolinine?

Some other synonyms for Glycozolinine are 3-Methyl-6-hydroxycarbazole, Glycozolinol, and 9H-Carbazol-3-ol, 6-methyl-.

What is the CAS number for Glycozolinine?

The CAS number for Glycozolinine is 5257-08-9.

What is the molecular formula of Glycozolinine?

The molecular formula of Glycozolinine is C13H11NO.

What is the molecular weight of Glycozolinine?

The molecular weight of Glycozolinine is 197.23.

What is the boiling point of Glycozolinine?

The boiling point of Glycozolinine is predicted to be 439.0±25.0 °C.

What is the density of Glycozolinine?

The density of Glycozolinine is predicted to be 1.308±0.06 g/cm3.

What is the predicted pKa value of Glycozolinine?

The predicted pKa value of Glycozolinine is 10.07±0.30.

※ Please kindly note that our products are for research use only.