6a,7-Dehydroboldine

6a,7-Dehydroboldine

Inquiry
Catalog Number ACM91599234
CAS Number 91599-23-4
Molecular Weight 325.4
InChI InChI=1S/C19H19NO4/c1-20-5-4-10-7-15(22)19(24-3)18-12-9-16(23-2)14(21)8-11(12)6-13(20)17(10)18/h6-9,21-22H,4-5H2,1-3H3
InChI Key XPRXRILREFALSL-UHFFFAOYSA-N
Purity 95%+
Complexity 461
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 325.13140809
Heavy Atom Count 24
Hydrogen Bond Acceptor Count 5
Hydrogen Bond Donor Count 2
Monoisotopic Mass 325.13140809
PhysicalState Powder
Rotatable Bond Count 2
Topological Polar Surface Area 62.2 Ų
Custom Q&A

What is the chemical formula for 6a,7-Dehydroboldine?

The chemical formula for 6a,7-Dehydroboldine is C19H19NO4.

What is the molecular weight of 6a,7-Dehydroboldine?

The molecular weight of 6a,7-Dehydroboldine is 325.36.

What is the CAS number for 6a,7-Dehydroboldine?

The CAS number for 6a,7-Dehydroboldine is 91599-23-4.

What is the predicted boiling point of 6a,7-Dehydroboldine?

The predicted boiling point of 6a,7-Dehydroboldine is 594.6±50.0 °C.

What is the predicted density of 6a,7-Dehydroboldine?

The predicted density of 6a,7-Dehydroboldine is 1.340±0.06 g/cm3.

What is the pka value of 6a,7-Dehydroboldine?

The pka value of 6a,7-Dehydroboldine is 9.77±0.20.

What are the synonyms for 6a,7-Dehydroboldine?

The synonyms for 6a,7-Dehydroboldine are 4H-Dibenzo[de,g]quinoline-2,9-diol, 5,6-dihydro-1,10-dimethoxy-6-methyl-.

What is the chemical structure of 6a,7-Dehydroboldine?

The chemical structure of 6a,7-Dehydroboldine is a 4H-Dibenzo[de,g]quinoline with 2,9-diol, 5,6-dihydro, 1,10-dimethoxy, and 6-methyl substitutions.

※ Please kindly note that our products are for research use only.