7-Acetylscorpioidine

Catalog Number	ACM80405170
CAS Number	80405-17-0
Molecular Weight	423.5
InChI	InChI=1S/C22H33NO7/c1-7-14(4)20(25)29-15(5)22(27,13(2)3)21(26)28-12-17-8-10-23-11-9-18(19(17)23)30-16(6)24/h7-8,13,15,18-19,27H,9-12H2,1-6H3/b14-7+/t15,18-,19-,22+/m1/s1
InChI Key	YYQUGDOAQAPTLK-BUNUPIFCSA-N
Purity	95%+
Complexity	742
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	3
Exact Mass	423.22570239
Heavy Atom Count	30
Hydrogen Bond Acceptor Count	8
Hydrogen Bond Donor Count	1
Isomeric SMILES	C/C=C(\C)/C(=O)OC(C)[C@@](C(C)C)(C(=O)OCC1=CCN2[C@H]1[C@@H](CC2)OC(=O)C)O
Monoisotopic Mass	423.22570239
PhysicalState	Powder
Rotatable Bond Count	11
Topological Polar Surface Area	102 Ų

Custom Q&A

What is the chemical formula of 7-Acetylscorpioidine?

The chemical formula of 7-Acetylscorpioidine is C22H33NO7.

What is the molecular weight of 7-Acetylscorpioidine?

The molecular weight of 7-Acetylscorpioidine is 423.5.

What is the CAS number of 7-Acetylscorpioidine?

The CAS number of 7-Acetylscorpioidine is 80405-17-0.

What are some synonyms for 7-Acetylscorpioidine?

Some synonyms for 7-Acetylscorpioidine include 2-Butenoic acid, 2-methyl-, 2-[[[1-(acetyloxy)-2,3,5,7a-tetrahydro-1H-pyrrolizin-7-yl]methoxy]carbonyl]-2-hydroxy-1,3-dimethylbutyl ester, [1R-[1α,7[1(E),2S*],7aβ]]-.

What is the predicted boiling point of 7-Acetylscorpioidine?

The predicted boiling point of 7-Acetylscorpioidine is 529.8±50.0 °C.

What is the predicted density of 7-Acetylscorpioidine?

The predicted density of 7-Acetylscorpioidine is 1.19±0.1 g/cm3.

What is the predicted pka value of 7-Acetylscorpioidine?

The predicted pka value of 7-Acetylscorpioidine is 11.76±0.29.

※ Please kindly note that our products are for research use only.