7-Ethyl-10-hydroxycamptothecin

Catalog Number	ACM86639523
CAS Number	86639-52-3
Structure
Synonyms	7-10-Hydroxycamptothecin
IUPAC Name	(19S)-10,19-diethyl-7,19-dihydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione
Molecular Weight	392.4
Molecular Formula	C22H20N2O5
Canonical SMILES	CCC1=C2CN3C(=CC4=C(C3=O)COC(=O)[C@@]4(CC)O)C2=NC5=C1C=C(C=C5)O
InChI	InChI=1S/C22H20N2O5/c1-3-12-13-7-11(25)5-6-17(13)23-19-14(12)9-24-18(19)8-16-15(20(24)26)10-29-21(27)22(16,28)4-2/h5-8,25,28H,3-4,9-10H2,1-2H3/t22-/m0/s1
InChI Key	FJHBVJOVLFPMQE-QFIPXVFZSA-N
Boiling Point	810.3±65.0 °C
Melting Point	217 °C
Purity	98%
Density	1.51±0.1 g/ml
Appearance	Powder
Complexity	820
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	1
Exact Mass	392.13722174
Heavy Atom Count	29
Hydrogen Bond Acceptor Count	6
Hydrogen Bond Donor Count	2
Isomeric SMILES	CCC1=C2CN3C(=CC4=C(C3=O)COC(=O)[C@@]4(CC)O)C2=NC5=C1C=C(C=C5)O
Monoisotopic Mass	392.13722174
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	100 Ų

Custom Q&A

What is the chemical name of the compound with the synonym 7-Ethyl-10-hydroxycamptothecin?

The chemical name is 4,11-Diethyl-4,9-dihydroxy-1H-pyrano[3',4':6,7]indolizino[1,2-b]quinoline-3,14(4H,12H)-dione.

What is the CAS number of 7-Ethyl-10-hydroxycamptothecin?

The CAS number is 130144-34-2.

What is the molecular formula of 7-Ethyl-10-hydroxycamptothecin?

The molecular formula is C22H20N2O5.

What is the molecular weight of 7-Ethyl-10-hydroxycamptothecin?

The molecular weight is 392.4.

What is the predicted boiling point of 7-Ethyl-10-hydroxycamptothecin?

The predicted boiling point is 810.3±65.0 °C.

What is the density of 7-Ethyl-10-hydroxycamptothecin?

The density is 1.51.

What is the pka value of 7-Ethyl-10-hydroxycamptothecin?

The pka value is 9.13±0.40.

How is 7-Ethyl-10-hydroxycamptothecin defined in ChEBI?

It is defined as LSM-6189, a pyranoindolizinoquinoline.

Is 7-Ethyl-10-hydroxycamptothecin commonly known by any other names?

Yes, it is also known as rac-7-Ethyl-10-Hydroxy camptothecin, rac-4,11-Diethyl-9-hydroxycamptothecin, and Camptothecin Impurity 21.

※ Please kindly note that our products are for research use only.