7-Hydroxy-beta-carboline-1-propionic acid

Catalog Number	ACM215934159
CAS Number	215934-15-9
Synonyms	7-Hydroxy-9H-pyrido[3,4-b]indole-1-propanoic acid
Molecular Weight	256.26
InChI	InChI=1S/C14H12N2O3/c17-8-1-2-9-10-5-6-15-11(3-4-13(18)19)14(10)16-12(9)7-8/h1-2,5-7,15-16H,3-4H2,(H,18,19)
InChI Key	MBOPWGSKAKJDIH-UHFFFAOYSA-N
Purity	95%+
Complexity	633
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	256.08479225
Heavy Atom Count	19
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	3
Monoisotopic Mass	256.08479225
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	78.4 Ų

Custom Q&A

What is the chemical name of the compound with CAS number 215934-15-9?

The chemical name of the compound with CAS number 215934-15-9 is 7-Hydroxy-beta-carboline-1-propionic acid.

What are some synonyms for 7-Hydroxy-beta-carboline-1-propionic acid?

Some synonyms for 7-Hydroxy-beta-carboline-1-propionic acid are 7-Hydroxy-9H-pyrido[3,4-b]indole-1-propanoic acid and 9H-Pyrido[3,4-b]indole-1-propanoic acid, 7-hydroxy-.

What is the molecular formula of 7-Hydroxy-beta-carboline-1-propionic acid?

The molecular formula of 7-Hydroxy-beta-carboline-1-propionic acid is C14H12N2O3.

What is the molecular weight of 7-Hydroxy-beta-carboline-1-propionic acid?

The molecular weight of 7-Hydroxy-beta-carboline-1-propionic acid is 256.26 g/mol.

What is the structure of 7-Hydroxy-beta-carboline-1-propionic acid?

The structure of 7-Hydroxy-beta-carboline-1-propionic acid consists of a beta-carboline ring with a hydroxyl group attached at position 7, and a propionic acid side chain.

What is the role of 7-Hydroxy-beta-carboline-1-propionic acid in biological systems?

7-Hydroxy-beta-carboline-1-propionic acid is known to have neuroprotective and antioxidant properties, making it potentially beneficial for the treatment of neurodegenerative diseases.

How is 7-Hydroxy-beta-carboline-1-propionic acid usually synthesized?

7-Hydroxy-beta-carboline-1-propionic acid can be synthesized through various chemical reactions involving beta-carboline derivatives and propionic acid derivatives.

Are there any known side effects or safety concerns associated with the use of 7-Hydroxy-beta-carboline-1-propionic acid?

Currently, there are no reported side effects or safety concerns associated with the use of 7-Hydroxy-beta-carboline-1-propionic acid, but additional research may be needed to confirm its safety profile.

In what type of research or pharmaceutical applications is 7-Hydroxy-beta-carboline-1-propionic acid commonly used?

7-Hydroxy-beta-carboline-1-propionic acid is commonly used in research related to neurodegenerative diseases, as well as in the development of potential therapeutics for such conditions.

※ Please kindly note that our products are for research use only.