9,10-Dimethoxycanthin-6-one

Catalog Number	ACM155861511
CAS Number	155861-51-1
Synonyms	9,10-Dimethoxy-6H-indolo[3,2,1-de][1,5]naphthyridin-6-one
Molecular Weight	280.28
InChI	InChI=1S/C16H12N2O3/c1-20-13-7-10-9-5-6-17-11-3-4-15(19)18(16(9)11)12(10)8-14(13)21-2/h3-8H,1-2H3
InChI Key	VKMIBFAQYHUWCU-UHFFFAOYSA-N
Purity	95%+
Complexity	466
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	280.08479225
Heavy Atom Count	21
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	0
Monoisotopic Mass	280.08479225
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	53.4 Ų

Custom Q&A

What is the chemical name of the compound with the CAS number 155861-51-1?

The chemical name of the compound is 9,10-Dimethoxycanthin-6-one.

What are some synonyms for 9,10-Dimethoxycanthin-6-one?

Some synonyms for 9,10-Dimethoxycanthin-6-one include 9,10-Dimethoxy-6H-indolo[3,2,1-de][1,5]naphthyridin-6-one and 10-Dimethoxycanthin-6-one.

What is the molecular formula of 9,10-Dimethoxycanthin-6-one?

The molecular formula is C16H12N2O3.

What is the molecular weight of 9,10-Dimethoxycanthin-6-one?

The molecular weight is 280.28.

What is the boiling point of 9,10-Dimethoxycanthin-6-one?

The boiling point is predicted to be 405.6±45.0 °C.

What is the density of 9,10-Dimethoxycanthin-6-one?

The density is predicted to be 1.40±0.1 g/cm3.

What is the pKa value of 9,10-Dimethoxycanthin-6-one?

The pKa value is predicted to be 4.23±0.20.

※ Please kindly note that our products are for research use only.