9-Angeloylretronecine N-oxide

Catalog Number	ACM27773860
CAS Number	27773-86-0
Structure
Molecular Weight	253.29
InChI	InChI=1S/C13H19NO4/c1-3-9(2)13(16)18-8-10-4-6-14(17)7-5-11(15)12(10)14/h3-4,11-12,15H,5-8H2,1-2H3/b9-3-/t11-,12-,14/m1/s1
InChI Key	HHIPTBVXCKBSAM-ZSXZLUMUSA-N
Melting Point	153-154 °C
Purity	95%+
Complexity	415
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	2
Exact Mass	253.13140809
Heavy Atom Count	18
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	1
Isomeric SMILES	C/C=C(/C)\C(=O)OCC1=CC[N+]2([C@H]1[C@@H](CC2)O)[O-]
Monoisotopic Mass	253.13140809
PhysicalState	Powder
Rotatable Bond Count	4
Topological Polar Surface Area	64.6 Ų

Custom Q&A

What is the product name of the chemical compound with CAS number 27773-86-0?

The product name is 9-Angeloylretronecine N-oxide.

What are some synonyms for 9-Angeloylretronecine N-oxide?

Some synonyms for 9-Angeloylretronecine N-oxide are 2-Butenoic acid, 2-methyl-, [(1R,7aR)-2,3,5,7a-tetrahydro-1-hydroxy-4-oxido-1H-pyrrolizin-7-yl]methyl ester, and (2Z)-.

What is the CAS number of 9-Angeloylretronecine N-oxide?

The CAS number is 27773-86-0.

What is the molecular formula of 9-Angeloylretronecine N-oxide?

The molecular formula is C13H19NO4.

What is the molecular weight of 9-Angeloylretronecine N-oxide?

The molecular weight is 253.29 g/mol.

What is the melting point of 9-Angeloylretronecine N-oxide?

The melting point is 153-154 °C.

What is the predicted pka value of 9-Angeloylretronecine N-oxide?

The predicted pka value is 13.57±0.40.

What is the chemical structure of 9-Angeloylretronecine N-oxide?

The chemical structure consists of 2-Butenoic acid, 2-methyl-, and a tetrahydro-1-hydroxy-4-oxido-1H-pyrrolizin-7-yl methyl ester.

Can 9-Angeloylretronecine N-oxide be used for organic synthesis?

Yes, it can be used for organic synthesis.

※ Please kindly note that our products are for research use only.