9-Hydroxycanthin-6-one

Catalog Number	ACM138544919
CAS Number	138544-91-9
Synonyms	9-Hydroxy-6H-indolo[3,2,1-de][1,5]naphthyridin-6-one
Molecular Weight	236.22
InChI	InChI=1S/C14H8N2O2/c17-8-1-2-9-10-5-6-15-11-3-4-13(18)16(14(10)11)12(9)7-8/h1-7,15H
InChI Key	YMNACIYZMIKRMM-UHFFFAOYSA-N
Purity	95%+
Complexity	699
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	236.058577502
Heavy Atom Count	18
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	1
Monoisotopic Mass	236.058577502
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	49.4 Ų

Custom Q&A

What is the chemical formula of 9-Hydroxycanthin-6-one?

The chemical formula of 9-Hydroxycanthin-6-one is C14H8N2O2.

What is the molecular weight of 9-Hydroxycanthin-6-one?

The molecular weight of 9-Hydroxycanthin-6-one is 236.23.

What is the CAS number for 9-Hydroxycanthin-6-one?

The CAS number for 9-Hydroxycanthin-6-one is 138544-91-9.

What is the boiling point of 9-Hydroxycanthin-6-one?

The predicted boiling point of 9-Hydroxycanthin-6-one is 410.1±45.0 °C.

What is the predicted density of 9-Hydroxycanthin-6-one?

The predicted density of 9-Hydroxycanthin-6-one is 1.53±0.1 g/cm3.

What is the pKa value of 9-Hydroxycanthin-6-one?

The predicted pKa value of 9-Hydroxycanthin-6-one is 8.86±0.20.

Where is 9-Hydroxycanthin-6-one isolated from?

9-Hydroxycanthin-6-one is isolated from the roots of Eurycoma longifolia.

What activity does 9-Hydroxycanthin-6-one exhibit?

9-Hydroxycanthin-6-one exhibits antineoplastic activity.

What are the synonyms for 9-Hydroxycanthin-6-one?

The synonyms for 9-Hydroxycanthin-6-one include 9-Hydroxy-6H-indolo[3,2,1-de][1,5]naphthyridin-6-one and 6H-Indolo[3,2,1-de][1,5]naphthyridin-6-one, 9-hydroxy-.

※ Please kindly note that our products are for research use only.