(9S)-10,11-Dihydrocinchonan-9-ol

Catalog Number	ACM485654-1
CAS Number	485-65-4
Structure
Synonyms	Dihydrocinchonine
Molecular Weight	296.4
InChI	InChI=1S/C19H24N2O/c1-2-13-12-21-10-8-14(13)11-18(21)19(22)16-7-9-20-17-6-4-3-5-15(16)17/h3-7,9,13-14,18-19,22H,2,8,10-12H2,1H3/t13-,14-,18+,19-/m0/s1
InChI Key	WFJNHVWTKZUUTR-QAMTZSDWSA-N
Melting Point	269-272 °C
Purity	98%+
Complexity	388
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	4
Exact Mass	296.188863393
Heavy Atom Count	22
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	1
Isomeric SMILES	CC[C@H]1CN2CC[C@H]1C[C@@H]2[C@H](C3=CC=NC4=CC=CC=C34)O
Monoisotopic Mass	296.188863393
PhysicalState	Solid
Rotatable Bond Count	3
Topological Polar Surface Area	36.4 Ų

Custom Q&A

What is the chemical formula of HYDROCINCHONINE?

The chemical formula of HYDROCINCHONINE is C19H24N2O.

What is the molecular weight of HYDROCINCHONINE?

The molecular weight of HYDROCINCHONINE is 296.41 g/mol.

What is the melting point of HYDROCINCHONINE?

The melting point of HYDROCINCHONINE is 269-272 °C.

What is the optical activity of HYDROCINCHONINE?

The optical activity of HYDROCINCHONINE is [α]20/D +197±4°, c = 0.25% in ethanol.

How soluble is HYDROCINCHONINE in water?

HYDROCINCHONINE is soluble in water at a concentration of 768.6mg/L at 25 ºC.

What is the hazard code for HYDROCINCHONINE?

The hazard code for HYDROCINCHONINE is Xn.

What is the primary usage of HYDROCINCHONINE?

HYDROCINCHONINE is used in the enantioselective hydrogenation of α-ketoesters and the enantioselective synthesis of functionalized α-aminophosphonic acid derivatives.

What is the chemical property of HYDROCINCHONINE related to its structure?

HYDROCINCHONINE is a cinchona alkaloid.

What is the safety statement associated with HYDROCINCHONINE?

The safety statement associated with HYDROCINCHONINE is 36/37.

What is the predicted pka value of HYDROCINCHONINE?

The predicted pka value of HYDROCINCHONINE is 12.98±0.20.

※ Please kindly note that our products are for research use only.