a-Chaconine

Catalog Number	ACM20562032
CAS Number	20562-03-2
Description	a-Chaconine is a genotoxic agent that inhibits the production of energy through mitochondrial electron transport and ATP synthesis. It binds to the matrix effect, which is a protective barrier against the passage of toxic substances from blood to other organs. This compound also has anti-inflammatory effects and is used in vitro assays for assessing the effects of chemical compounds on cell growth. a-Chaconine has been shown to inhibit acetylcholinesterase activity in rats, leading to acute toxicities such as respiratory depression. This compound also causes DNA strand breaks in vitro, and can be detected using polymerase chain reaction (PCR) analysis.
Synonyms	(3b)-Solanid-5-en-3-yl O-6-deoxy-a-L-mannopyranosyl-(1-2)-O-(6-deoxy-a-L-mannopyranosyl-(1-4))-b-D-glucopyranoside
Molecular Weight	852.06 g/mol
Molecular Formula	C45H73NO14
Canonical SMILES	C[C@H]1CC[C@@H]2[C@H]([C@H]3[C@@H](N2C1)C[C@@H]4[C@@]3(CC[C@H]5[C@H]4CC=C6[C@@]5(CC[C@@H](C6)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O[C@H]8[C@@H]([C@@H]([C@H]([C@@H](O8)C)O)O)O)O)O[C@H]9[C@@H]([C@@H]([C@H]([C@@H](O9)C)O)O)O)C)C)C
Storage	store at 10℃-25℃
Harmonized Tariff Code	Switzerland: 29397900 - USA: 2939790000 - Slovakia: 2939791000 - UK: 2939790000 - China: 2939799091
MDL Number	MFCD09039102

Custom Q&A

What is the chemical formula for α-Chaconine?

The chemical formula for α-Chaconine is C45H73NO14.

What is the melting point of α-Chaconine?

The melting point of α-Chaconine is 228-236 °C.

What is the solubility of α-Chaconine in pyridine?

The solubility of α-Chaconine in pyridine is 10 mg/mL.

What is the color of α-Chaconine?

α-Chaconine is white to off-white in color.

Is α-Chaconine stable?

α-Chaconine is hygroscopic and stable.

What is the hazard code for α-Chaconine?

The hazard code for α-Chaconine is Xn.

What is the potential use of α-Chaconine?

α-Chaconine is a glycoalkaloid displaying nerve toxin activity and potential antifungal activity.

What is the hazard class of α-Chaconine?

The hazard class of α-Chaconine is 6.1(b).

What is the packing group of α-Chaconine?

The packing group of α-Chaconine is III.

What is the safety statement for α-Chaconine?

The safety statements for α-Chaconine are 22-36/37.

※ Please kindly note that our products are for research use only.