Abrine

Catalog Number	ACM526318-2
CAS Number	526-31-8
Synonyms	N-Methyl-L-tryptophan
IUPAC Name	(2S)-3-(1H-Indol-3-yl)-2-(methylamino)propanoic acid
Molecular Weight	218.25
Molecular Formula	C12H14N2O2
Canonical SMILES	CNC(CC1=CNC2=CC=CC=C21)C(=O)O
InChI	InChI=1S/C12H14N2O2/c1-13-11(12(15)16)6-8-7-14-10-5-3-2-4-9(8)10/h2-5,7,11,13-14H,6H2,1H3,(H,15,16)/t11-/m0/s1
InChI Key	CZCIKBSVHDNIDH-NSHDSACASA-N
Purity	98%+ (HPLC)
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	257
Exact Mass	218.105527694
Heavy Atom Count	16
Isomeric SMILES	CN[C@@H](CC1=CNC2=CC=CC=C21)C(=O)O
Monoisotopic Mass	218.105527694
Topological Polar Surface Area	65.1Ų

Custom Q&A

What is the chemical formula of L-ABRINE?

The chemical formula of L-ABRINE is C12H14N2O2.

What is the molecular weight of L-ABRINE?

The molecular weight of L-ABRINE is 218.25.

What is the melting point of L-ABRINE?

The melting point of L-ABRINE is greater than 300 °C.

What are the hazard codes associated with L-ABRINE?

The hazard code associated with L-ABRINE is Xn.

What are the risk statements associated with L-ABRINE?

The risk statements associated with L-ABRINE are 20/21/22.

What are the safety statements associated with L-ABRINE?

The safety statements associated with L-ABRINE are 36.

What is the usage of L-ABRINE?

L-ABRINE is an indoleamino acid that displays radical scavenging and antioxidant properties.

How can L-ABRINE be purified?

L-ABRINE can be purified by crystallization from H2O or EtOH/H2O mixture and drying it in high vacuum.

What is the optical activity of L-ABRINE?

The optical activity of L-ABRINE is [α]20/D +65°, c = 1 in 0.5 M NaOH.

What are the chemical properties of L-ABRINE?

L-ABRINE is a white to light grey crystalline powder or crystals.

※ Please kindly note that our products are for research use only.