Abrine

Abrine

Inquiry
Catalog Number ACM526318-2
CAS Number 526-31-8
Structure
Synonyms N-Methyl-L-tryptophan
IUPAC Name (2S)-3-(1H-Indol-3-yl)-2-(methylamino)propanoic acid
Molecular Weight 218.25
Molecular Formula C12H14N2O2
Canonical SMILES CNC(CC1=CNC2=CC=CC=C21)C(=O)O
InChI InChI=1S/C12H14N2O2/c1-13-11(12(15)16)6-8-7-14-10-5-3-2-4-9(8)10/h2-5,7,11,13-14H,6H2,1H3,(H,15,16)/t11-/m0/s1
InChI Key CZCIKBSVHDNIDH-NSHDSACASA-N
Purity 98%+ (HPLC)
Storage Store in dry, low temperature, sealed, 2-8 °C.
Complexity 257
Exact Mass 218.105527694
Heavy Atom Count 16
Isomeric SMILES CN[C@@H](CC1=CNC2=CC=CC=C21)C(=O)O
Monoisotopic Mass 218.105527694
Topological Polar Surface Area 65.1Ų
Custom Q&A

What is the chemical formula of L-ABRINE?

The chemical formula of L-ABRINE is C12H14N2O2.

What is the molecular weight of L-ABRINE?

The molecular weight of L-ABRINE is 218.25.

What is the melting point of L-ABRINE?

The melting point of L-ABRINE is greater than 300 °C.

What are the hazard codes associated with L-ABRINE?

The hazard code associated with L-ABRINE is Xn.

What are the risk statements associated with L-ABRINE?

The risk statements associated with L-ABRINE are 20/21/22.

What are the safety statements associated with L-ABRINE?

The safety statements associated with L-ABRINE are 36.

What is the usage of L-ABRINE?

L-ABRINE is an indoleamino acid that displays radical scavenging and antioxidant properties.

How can L-ABRINE be purified?

L-ABRINE can be purified by crystallization from H2O or EtOH/H2O mixture and drying it in high vacuum.

What is the optical activity of L-ABRINE?

The optical activity of L-ABRINE is [α]20/D +65°, c = 1 in 0.5 M NaOH.

What are the chemical properties of L-ABRINE?

L-ABRINE is a white to light grey crystalline powder or crystals.

※ Please kindly note that our products are for research use only.