Acetonylchelerythrine

Catalog Number	ACM22864922
CAS Number	22864-92-2
Structure
Synonyms	13-(2-Oxopropyl)dihydrochelerythrine
Molecular Weight	405.4
InChI	InChI=1S/C24H23NO5/c1-13(26)9-18-22-15(7-8-19(27-3)24(22)28-4)16-6-5-14-10-20-21(30-12-29-20)11-17(14)23(16)25(18)2/h5-8,10-11,18H,9,12H2,1-4H3/t18-/m0/s1
InChI Key	VGTQLFWIJIABSU-SFHVURJKSA-N
Melting Point	199 °C
Purity	95%+
Complexity	643
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	1
Exact Mass	405.15762283
Heavy Atom Count	30
Hydrogen Bond Acceptor Count	6
Hydrogen Bond Donor Count	0
Isomeric SMILES	CC(=O)C[C@H]1C2=C(C=CC(=C2OC)OC)C3=C(N1C)C4=CC5=C(C=C4C=C3)OCO5
Monoisotopic Mass	405.15762283
PhysicalState	Powder
Rotatable Bond Count	4
Topological Polar Surface Area	57.2 Ų

Custom Q&A

What is the chemical name of Acetonylchelerythrine?

The chemical name of Acetonylchelerythrine is 6-Acetonyldihydrochelerythrine.

What are some synonyms for Acetonylchelerythrine?

Some synonyms for Acetonylchelerythrine are 13-(2-Oxopropyl)dihydrochelerythrine, 13-Acetonyldihydrochelerythrine, Acetonylchelerythrine, Acetonyldihydrochelerythrine, and Chelerythrine acetonate.

What is the CAS number of Acetonylchelerythrine?

The CAS number of Acetonylchelerythrine is 22864-92-2.

What is the molecular formula of Acetonylchelerythrine?

The molecular formula of Acetonylchelerythrine is C24H23NO5.

What is the molecular weight of Acetonylchelerythrine?

The molecular weight of Acetonylchelerythrine is 405.44.

What is the melting point of 6-Acetonyldihydrochelerythrine?

The melting point of 6-Acetonyldihydrochelerythrine is 199 °C.

What is the boiling point of 6-Acetonyldihydrochelerythrine?

The predicted boiling point of 6-Acetonyldihydrochelerythrine is 595.7±50.0 °C.

What is the density of 6-Acetonyldihydrochelerythrine?

The predicted density of 6-Acetonyldihydrochelerythrine is 1.260±0.06 g/cm3.

What is the predicted pKa of 6-Acetonyldihydrochelerythrine?

The predicted pKa of 6-Acetonyldihydrochelerythrine is 1.67±0.40.

※ Please kindly note that our products are for research use only.