Acetylcephalotaxine

Acetylcephalotaxine

Inquiry
Catalog Number ACM24274600
CAS Number 24274-60-0
Structure
Synonyms Cephalotaxine acetate
Molecular Weight 357.4
InChI InChI=1S/C20H23NO5/c1-12(22)26-19-17(23-2)10-20-5-3-6-21(20)7-4-13-8-15-16(25-11-24-15)9-14(13)18(19)20/h8-10,18-19H,3-7,11H2,1-2H3
InChI Key WZFZRXGNVSHCOI-UHFFFAOYSA-N
Purity 95%+
Complexity 621
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 357.15762283
Heavy Atom Count 26
Hydrogen Bond Acceptor Count 6
Hydrogen Bond Donor Count 0
Monoisotopic Mass 357.15762283
PhysicalState Powder
Rotatable Bond Count 3
Topological Polar Surface Area 57.2 Ų
Custom Q&A

What is the synonym for Acetylcephalotaxine?

The synonym for Acetylcephalotaxine is Cephalotaxine acetate.

What is the chemical formula for Acetylcephalotaxine?

The chemical formula for Acetylcephalotaxine is C20H23NO5.

What is the molecular weight of Acetylcephalotaxine?

The molecular weight of Acetylcephalotaxine is 357.4.

In what forms is Acetylcephalotaxine soluble?

Acetylcephalotaxine is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

How does Acetylcephalotaxine occur naturally?

Acetylcephalotaxine can be found in Cephalotaxus Jortunei, where it yields as a minor alkaloid that crystallizes as colourless rods from EtOH.

How does Acetylcephalotaxine appear physically?

Acetylcephalotaxine appears in the form of a powder.

What is the CAS number for Acetylcephalotaxine?

The CAS number for Acetylcephalotaxine is 24274-60-0.

How is Acetylcephalotaxine used in laboratories?

Acetylcephalotaxine is used in laboratories for chemical research and experimentation.

What are some common solvents that Acetylcephalotaxine is soluble in?

Acetylcephalotaxine is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, and more.

※ Please kindly note that our products are for research use only.