Acetylcorynoline

Catalog Number	ACM18797803-1
CAS Number	18797-80-3
Synonyms	Corynoline acetate
IUPAC Name	[(1R,12S,13R)-13,24-Dimethyl-5,7,18,20-tetraoxa-24-azahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-2,4(8),9,14(22),15,17(21)-hexaen-12-yl] acetate
Molecular Weight	409.43
Molecular Formula	C23H23NO6
Canonical SMILES	CC(=O)OC1CC2=CC3=C(C=C2C4C1(C5=C(CN4C)C6=C(C=C5)OCO6)C)OCO3
InChI	InChI=1S/C23H23NO6/c1-12(25)30-20-7-13-6-18-19(28-10-27-18)8-14(13)22-23(20,2)16-4-5-17-21(29-11-26-17)15(16)9-24(22)3/h4-6,8,20,22H,7,9-11H2,1-3H3/t20-,22+,23-/m0/s1
InChI Key	PUHCFWFODBLSAP-WWNPGLIZSA-N
Purity	98%+ (HPLC)
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	703
Exact Mass	409.15253745
Heavy Atom Count	30
Isomeric SMILES	CC(=O)O[C@H]1CC2=CC3=C(C=C2[C@@H]4[C@]1(C5=C(CN4C)C6=C(C=C5)OCO6)C)OCO3
Monoisotopic Mass	409.15253745
Topological Polar Surface Area	66.5Ų

Custom Q&A

What is the chemical name of Acetylcorynoline?

The chemical name of Acetylcorynoline is 13-Methylchelidonan-11β-ol acetate.

What is the molecular formula of Acetylcorynoline?

The molecular formula of Acetylcorynoline is C23H23NO6.

What are some synonyms for Acetylcorynoline?

Some synonyms for Acetylcorynoline are ACETYLCORYNOLINE and Acetic acid (5bR)-5bα,13-dimethyl-5bα,6,7,12bα,13,14-hexahydro[1,3]benzodioxolo[5,6-c]-1,3-dioxolo[4,5-i]phenanthridine-6β-yl ester.

From which plant is Acetylcorynoline extracted?

Acetylcorynoline is extracted from Corydalis bungeana Herba.

What are some pharmacological activities displayed by Acetylcorynoline?

Acetylcorynoline displays various pharmacological activities.

How is Acetylcorynoline typically obtained?

Acetylcorynoline is typically obtained through the extraction of alkaloids from Corydalis bungeana Herba.

Is Acetylcorynoline a natural compound?

Yes, Acetylcorynoline is a natural compound.

What group does Acetylcorynoline belong to?

Acetylcorynoline belongs to the group of alkaloids.

※ Please kindly note that our products are for research use only.