Acetylheliosupine

Catalog Number	ACM31514304
CAS Number	31514-30-4
Structure
Synonyms	2-Butenoic acid, 2-methyl-, (1S,7aR)-7-[[(2S)-2-[(1S)-1-(acetyloxy)ethyl]-2,3-dihydroxy-3-methyl-1-oxobutoxy]methyl]-2,3,5,7a-tetrahydro-1H-pyrrolizin-1-yl ester, (2Z)- (9CI)
Molecular Weight	439.5
InChI	InChI=1S/C22H33NO8/c1-7-13(2)19(25)31-17-9-11-23-10-8-16(18(17)23)12-29-20(26)22(28,21(5,6)27)14(3)30-15(4)24/h7-8,14,17-18,27-28H,9-12H2,1-6H3/b13-7-/t14-,17-,18-,22+/m0/s1
InChI Key	LHYJPODIMQKZHJ-ZUFLKMKTSA-N
Purity	95%+
Complexity	786
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	4
Exact Mass	439.22061701
Heavy Atom Count	31
Hydrogen Bond Acceptor Count	9
Hydrogen Bond Donor Count	2
Isomeric SMILES	C/C=C(/C)\C(=O)O[C@H]1CCN2[C@H]1C(=CC2)COC(=O)[C@]([C@H](C)OC(=O)C)(C(C)(C)O)O
Monoisotopic Mass	439.22061701
PhysicalState	Powder
Rotatable Bond Count	11
Topological Polar Surface Area	123 Ų

Custom Q&A

What is the product name of the chemical compound with CAS number 31514-30-4?

The product name is Acetylheliosupine.

What are some synonyms for Acetylheliosupine?

Some synonyms include 2-Butenoic acid, 2-methyl-, (1S,7aR)-7-[[(2S)-2-[(1S)-1-(acetyloxy)ethyl]-2,3-dihydroxy-3-methyl-1-oxobutoxy]methyl]-2,3,5,7a-tetrahydro-1H-pyrrolizin-1-yl ester, (2Z)- (9CI).

What is the CAS number for Acetylheliosupine?

The CAS number is 31514-30-4.

What is the molecular formula of Acetylheliosupine?

The molecular formula is C22H33NO8.

What is the molecular weight of Acetylheliosupine?

The molecular weight is 439.5.

What is the chemical structure of Acetylheliosupine?

The chemical structure of Acetylheliosupine is (2Z)-C22H33NO8.

What are some potential uses of Acetylheliosupine?

Acetylheliosupine may be used in pharmaceutical research or as a reference in chemical analysis.

Is Acetylheliosupine a natural compound?

Acetylheliosupine is a semi-synthetic compound derived from natural sources.

How is Acetylheliosupine typically synthesized?

Acetylheliosupine is typically synthesized by acetylating and modifying a natural compound to produce the desired structure.

※ Please kindly note that our products are for research use only.