Acetylintermedine

Catalog Number	ACM74243019
CAS Number	74243-01-9
Synonyms	7-Acetylintermedine
Molecular Weight	341.4
InChI	InChI=1S/C17H27NO6/c1-10(2)17(22,11(3)19)16(21)23-9-13-5-7-18-8-6-14(15(13)18)24-12(4)20/h5,10-11,14-15,19,22H,6-9H2,1-4H3/t11-,14-,15-,17+/m1/s1
InChI Key	RKDOFSJTBIDAHX-CYHLAULCSA-N
Purity	95%+
Complexity	531
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	4
Exact Mass	341.18383758
Heavy Atom Count	24
Hydrogen Bond Acceptor Count	7
Hydrogen Bond Donor Count	2
Isomeric SMILES	C[C@H]([C@@](C(C)C)(C(=O)OCC1=CCN2[C@H]1[C@@H](CC2)OC(=O)C)O)O
Monoisotopic Mass	341.18383758
PhysicalState	Powder
Rotatable Bond Count	8
Topological Polar Surface Area	96.3 Ų

Custom Q&A

What is the chemical structure of 7-ACETYLLYCOPSAMINE?

(2S,3R)-2,3-Dihydroxy-2-(1-methylethyl)butanoic acid [(1R,7aβ)-1α-(acetyloxy)-2,3,5,7a-tetrahydro-1H-pyrrolizin-7-yl]methyl ester

What are some synonyms for 7-ACETYLLYCOPSAMINE?

Acetylintermedine, Intermedine 1-acetate, O7-Acetylintermedine, 7-O-Acetylintermedine, etc.

What is the molecular formula of 7-ACETYLLYCOPSAMINE?

C17H27NO6

What is the molecular weight of 7-ACETYLLYCOPSAMINE?

341.4

How is 7-ACETYLLYCOPSAMINE commonly used?

It is a constituent or metabolite of pyrrolizidine alkaloid comfrey consumed by humans and used for herbal medicine.

What is the CAS number of 7-ACETYLLYCOPSAMINE?

74243-01-9

What are the safety implications of 7-ACETYLLYCOPSAMINE?

RIDADR: 1544, HazardClass: 6.1(b), PackingGroup: III

What is the role of Acetylintermedine in the pyrrolizines?

Acetylintermedine is a member of pyrrolizines.

How is Acetylintermedine related to herbal medicine?

Acetylintermedine is a constituent of comfrey, a plant used in herbal medicine.

Why is it important to be aware of the usage and synthesis of 7-ACETYLLYCOPSAMINE?

It is important for understanding its potential effects when consumed by humans and for ensuring safe practices in herbal medicine.

※ Please kindly note that our products are for research use only.