Acetylpseudotropine

Catalog Number	ACM3423265
CAS Number	3423-26-5
Molecular Weight	183.25
InChI	InChI=1S/C10H17NO2/c1-7(12)13-10-5-8-3-4-9(6-10)11(8)2/h8-10H,3-6H2,1-2H3
InChI Key	MDIDMOWWLBGYPG-UHFFFAOYSA-N
Purity	95%+
Complexity	203
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	183.125928785
Heavy Atom Count	13
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	0
Monoisotopic Mass	183.125928785
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	29.5 Ų

Custom Q&A

What is the chemical formula for Acetylpseudotropine?

The chemical formula for Acetylpseudotropine is C10H17NO2.

What is the molecular weight of Acetylpseudotropine?

The molecular weight of Acetylpseudotropine is 183.24748.

What are some synonyms for Acetylpseudotropine?

Some synonyms for Acetylpseudotropine are C12453 and 8-Azabicyclo[3.2.1]octan-3-ol, 8-methyl-, 3-acetate, (3-exo)-.

What is the boiling point of Acetylpseudotropine?

The boiling point of Acetylpseudotropine is predicted to be 231.6±33.0 °C.

In what solvents is Acetylpseudotropine soluble?

Acetylpseudotropine is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What form does Acetylpseudotropine typically take?

Acetylpseudotropine typically appears as an oil.

What is the pKa value of Acetylpseudotropine?

The pKa value of Acetylpseudotropine is predicted to be 10.36±0.40.

What is the usage of Acetylpseudotropine?

Acetylpseudotropine is a tropane alkaloid.

Is Acetylpseudotropine a ChEBI compound?

Yes, Acetylpseudotropine is considered a ChEBI compound.

What are chemicals that Acetylpseudotropine soluble in?

Acetylpseudotropine is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, and Acetone, among others.

※ Please kindly note that our products are for research use only.