Adonifoline

Catalog Number	ACM115712884
CAS Number	115712-88-4
Structure
Synonyms	(7aR,12bR)-7a,8,9,11,12b,13-Hexahydro-5-hydroxy-4,15a-dimethyl-2H-1a,5-methano-4H-oxireno[12,13][1,5,10]trioxacyclotetradecino[6,7,8-gh]pyrrolizine-6,15(5H,15aH)-dione
Molecular Weight	365.4
InChI	InChI=1S/C18H23NO7/c1-10-18(22)8-17(9-24-10)16(2,26-17)14(20)23-7-11-3-5-19-6-4-12(13(11)19)25-15(18)21/h3,10,12-13,22H,4-9H2,1-2H3/t10,12-,13-,16,17,18/m1/s1
InChI Key	MYOFCWPLRKBPJD-AQYQBICXSA-N
Purity	95%+
Complexity	722
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	2
Exact Mass	365.14745207
Heavy Atom Count	26
Hydrogen Bond Acceptor Count	8
Hydrogen Bond Donor Count	1
Isomeric SMILES	CC1C2(CC3(CO1)C(O3)(C(=O)OCC4=CCN5[C@H]4[C@@H](CC5)OC2=O)C)O
Monoisotopic Mass	365.14745207
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	97.8 Ų

Custom Q&A

What is the chemical formula of Adonifoline?

The chemical formula of Adonifoline is C18H23NO7.

What is the molecular weight of Adonifoline?

The molecular weight of Adonifoline is 365.38.

What are some synonyms of Adonifoline?

Some synonyms of Adonifoline include Adonifoline and (7aR,12bR)-7a,8,9,11,12b,13-Hexahydro-5-hydroxy-4,15a-dimethyl-2H-1a,5-methano-4H-oxireno[12,13][1,5,10]trioxacyclotetradecino[6,7,8-gh]pyrrolizine-6,15(5H,15aH)-dione.

What is the boiling point of Adonifoline?

The boiling point of Adonifoline is predicted to be 621.1 ± 55.0 °C.

What is the density of Adonifoline?

The density of Adonifoline is predicted to be 1.46 ± 0.1 g/cm3.

What is the pka value of Adonifoline?

The pka value of Adonifoline is predicted to be 12.07 ± 0.60.

What is the molar mass of Adonifoline?

The molar mass of Adonifoline is 365.38 g/mol.

Are there any other chemical properties mentioned for Adonifoline?

Yes, the pka value of Adonifoline is also mentioned as 12.07 ± 0.60.

How is the molecular structure of Adonifoline?

The molecular structure of Adonifoline is described as a pyrrolizine-6,15(5H,15aH)-dione with specific arrangements of carbon, hydrogen, nitrogen, and oxygen atoms.

※ Please kindly note that our products are for research use only.