Adouetine Y

Catalog Number	ACM19542382
CAS Number	19542-38-2
Structure
Description	Adouetine Y is an anti-inflammatory agent that is used to treat allergic rhinitis. It has been shown to have a potent anti-inflammatory effect, which may be due to its ability to inhibit the production of prostaglandins. Adouetine Y is extracted from natural sources and has been shown to be effective in treating allergic rhinitis.
Molecular Weight	568.71 g/mol
Molecular Formula	C34H40N4O4
Canonical SMILES	CC[C@H](C)[C@H]1C(=O)N/C=C\C2=CC=C(C=C2)O[C@@H]([C@@H](C(=O)N1)NC(=O)[C@H](CC3=CC=CC=C3)N(C)C)C4=CC=CC=C4

Custom Q&A

What is the chemical formula for Adonetine Y?

The chemical formula for Adonetine Y is C34H40N4O4.

What is the molecular weight of Adonetine Y?

The molecular weight of Adonetine Y is 568.7058.

What is the CAS number for Adonetine Y?

The CAS number for Adonetine Y is 19542-38-2.

What is the predicted boiling point of Adonetine Y?

The predicted boiling point of Adonetine Y is 847.6±65.0 °C.

What is the predicted density of Adonetine Y?

The predicted density of Adonetine Y is 1.20±0.1 g/cm3.

What is the predicted pKa value of Adonetine Y?

The predicted pKa value of Adonetine Y is 13.02±0.60.

How is Adonetine Y defined according to ChEBI?

Adouetine Y is defined as a cyclic peptide according to ChEBI.

What are the synonyms for Adonetine Y?

The synonyms for Adonetine Y include Adonetine Y, Adouetine Y, and Benzenepropanamide.

How is Adonetine Y typically used?

Adonetine Y is a cyclic peptide that is typically used in research and pharmaceutical applications.

※ Please kindly note that our products are for research use only.