Adrenalone hydrochloride

Adrenalone hydrochloride

Inquiry
Catalog Number ACM62135
CAS Number 62-13-5
Structure
Synonyms 1-(3,4-Dihydroxyphenyl)-2-(methylamino)ethanone;hydrochloride
Molecular Weight 217.65
InChI InChI=1S/C9H11NO3.ClH/c1-10-5-9(13)6-2-3-7(11)8(12)4-6;/h2-4,10-12H,5H2,1H3;1H
InChI Key CSRRBDMYOUQTCO-UHFFFAOYSA-N
Melting Point 244-249 °C
Purity 98%+
Complexity 184
Covalently-Bonded Unit Count 2
Defined Atom Stereocenter Count 0
Exact Mass 217.0505709
Heavy Atom Count 14
Hydrogen Bond Acceptor Count 4
Hydrogen Bond Donor Count 4
Monoisotopic Mass 217.0505709
PhysicalState Solid
Rotatable Bond Count 3
Topological Polar Surface Area 69.6 Ų
Custom Q&A

What is the chemical formula of Adrenalone hydrochloride?

The chemical formula of Adrenalone hydrochloride is C9H12ClNO3.

What is the molecular weight of Adrenalone hydrochloride?

The molecular weight of Adrenalone hydrochloride is 217.65.

What is the CAS number of Adrenalone hydrochloride?

The CAS number of Adrenalone hydrochloride is 62-13-5.

What is the melting point of Adrenalone hydrochloride?

The melting point of Adrenalone hydrochloride is 244-249 °C (dec.).

How should Adrenalone hydrochloride be stored?

Adrenalone hydrochloride should be stored at 2-8°C.

What is the water solubility of Adrenalone hydrochloride?

The water solubility of Adrenalone hydrochloride is almost transparency.

What is the safety statement associated with Adrenalone hydrochloride?

The safety statements for Adrenalone hydrochloride are 22-24/25.

What is the usage of Adrenalone hydrochloride?

Adrenalone hydrochloride is used as an adrenergic (ophthalmic).

What activity does Adrenalone hydrochloride display?

Adrenalone displays antineoplastic activity and has been shown to inhibit growth of Ehrlich ascites tumors in mice.

How is Adrenalone hydrochloride prepared?

Adrenalone hydrochloride is obtained by the action of hydrochloric acid on 3,4-dihydroxy-a-methylaminoacetophenone (65%), in methanol.

※ Please kindly note that our products are for research use only.