Ajmalidine

Ajmalidine

Inquiry
Catalog Number ACM639305
CAS Number 639-30-5
Structure
Synonyms 21α-Hydroxyajmalan-17-one
Molecular Weight 324.4
InChI InChI=1S/C20H24N2O2/c1-3-10-11-8-14-17-20(12-6-4-5-7-13(12)21(17)2)9-15(16(11)18(20)23)22(14)19(10)24/h4-7,10-11,14-17,19,24H,3,8-9H2,1-2H3/t10-,11-,14-,15-,16,17-,19+,20+/m0/s1
InChI Key JLUFXYAXVHAFTF-YNSIMGNASA-N
Purity 95%+
Complexity 608
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 7
Exact Mass 324.183778013
Heavy Atom Count 24
Hydrogen Bond Acceptor Count 4
Hydrogen Bond Donor Count 1
Isomeric SMILES CC[C@H]1[C@@H]2C[C@H]3[C@H]4[C@@]5(C[C@@H](C2C5=O)N3[C@@H]1O)C6=CC=CC=C6N4C
Monoisotopic Mass 324.183778013
PhysicalState Powder
Rotatable Bond Count 1
Topological Polar Surface Area 43.8 Ų
Custom Q&A

What is the chemical formula of Ajmalidine?

The chemical formula of Ajmalidine is C20H24N2O2.

What is the molecular weight of Ajmalidine?

The molecular weight of Ajmalidine is 324.42 g/mol.

What is the melting point of Ajmalidine?

The melting point of Ajmalidine is 241-242 °C.

In what solvent is Ajmalidine soluble?

Ajmalidine is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What is the predicted boiling point of Ajmalidine?

The predicted boiling point of Ajmalidine is 515.0±50.0 °C.

What is the density of Ajmalidine?

The density of Ajmalidine is 1.37±0.1 g/cm3.

What is the form of Ajmalidine?

Ajmalidine is in the form of a powder.

What is the pka value of Ajmalidine?

The pka value of Ajmalidine is 13.76±0.40.

What are some synonyms for 21α-Hydroxyajmalan-17-one?

Some synonyms for 21α-Hydroxyajmalan-17-one are Ajmalidine and (21alpha)-21-Hydroxyajmalan-17-one.

What is the CAS number of Ajmalidine?

The CAS number of Ajmalidine is 639-30-5.

※ Please kindly note that our products are for research use only.