Akuammidine

Catalog Number	ACM639361
CAS Number	639-36-1
Synonyms	(+)-Polyneuridine
Molecular Weight	352.4
InChI	InChI=1S/C21H24N2O3/c1-3-12-10-23-17-9-15(12)21(11-24,20(25)26-2)18(23)8-14-13-6-4-5-7-16(13)22-19(14)17/h3-7,15,17-18,22,24H,8-11H2,1-2H3/b12-3-/t15-,17-,18-,21-/m0/s1
InChI Key	RCEFXZXHYFOPIE-GJZACXSBSA-N
Melting Point	243-246 °C
Purity	95%+
Complexity	635
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	4
Exact Mass	352.17869263
Heavy Atom Count	26
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	2
Isomeric SMILES	C/C=C\1/CN2[C@H]3C[C@@H]1[C@]([C@@H]2CC4=C3NC5=CC=CC=C45)(CO)C(=O)OC
Monoisotopic Mass	352.17869263
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	65.6 Ų

Custom Q&A

What is the chemical formula for (+)-Polyneuridine?

The chemical formula for (+)-Polyneuridine is C21H24N2O3.

What is the molecular weight of (+)-Polyneuridine?

The molecular weight of (+)-Polyneuridine is 352.43.

What is the CAS number for (+)-Polyneuridine?

The CAS number for (+)-Polyneuridine is 639-36-1.

What is the melting point of (+)-Polyneuridine?

The melting point of (+)-Polyneuridine is 243-246℃.

What is the boiling point of (+)-Polyneuridine?

The boiling point of (+)-Polyneuridine is predicted to be 513.0±50.0 °C.

What is the density of (+)-Polyneuridine?

The density of (+)-Polyneuridine is predicted to be 1.34±0.1 g/cm3.

What is the pka value of (+)-Polyneuridine?

The pka value of (+)-Polyneuridine is predicted to be 14.79±0.10.

What are some synonyms for (+)-Polyneuridine?

Some synonyms for (+)-Polyneuridine are 17-Hydroxysarpagane-16-carboxylic acid methyl ester, Rhazin, SARPAGAN-16-CARBOXYLIC ACID17-HYDROXY-,METHYL ESTER, Akuammidine, and Rhazine.

※ Please kindly note that our products are for research use only.