Allomatrine

Catalog Number	ACM641394
CAS Number	641-39-4
Synonyms	4-(2-Biphenylyl)-1-(hydroxymethyl)-10-oxa-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione
Molecular Weight	248.36
InChI	InChI=1S/C15H24N2O/c18-14-7-1-6-13-12-5-3-9-16-8-2-4-11(15(12)16)10-17(13)14/h11-13,15H,1-10H2/t11-,12+,13+,15+/m0/s1
InChI Key	ZSBXGIUJOOQZMP-KYEXWDHISA-N
Melting Point	106-107 °C
Purity	98%+
Complexity	356
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	4
Exact Mass	248.188863393
Heavy Atom Count	18
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	0
Isomeric SMILES	C1C[C@@H]2[C@H]3CCCN4[C@@H]3[C@@H](CCC4)CN2C(=O)C1
Monoisotopic Mass	248.188863393
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	23.6 Ų

Custom Q&A

What are some synonyms for ALLOMATRINE?

6β-Matrine; 6-Allomatrine; Tetrahydroisosophoramine

What is the CAS number for ALLOMATRINE?

641-39-4

What is the molecular formula of ALLOMATRINE?

C15H24N2O

What is the molecular weight of ALLOMATRINE?

248.36

What is the melting point of ALLOMATRINE?

106-107 ºC

In what solvents is ALLOMATRINE soluble?

Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What is the predicted boiling point of ALLOMATRINE?

396.7±31.0 °C

What is the predicted pKa value of ALLOMATRINE?

9.47±0.20

What are some of the targets of ALLOMATRINE in terms of usage and synthesis?

Bcl-2/Bax, Caspase, Akt, ROS, NF-kB, CDK

What is the form of ALLOMATRINE?

Powder

※ Please kindly note that our products are for research use only.