Alpha-belladonnine

Alpha-belladonnine

Inquiry
Catalog Number ACM5878331
CAS Number 5878-33-1
Structure
Synonyms Bis(8-methyl-8-azabicyclo[3.2.1]oct-3-yl) 1,2,3,4-tetrahydro-1-phenylnaphthalene-1,4-dicarboxylate
Molecular Weight 542.7
InChI InChI=1S/C34H42N2O4/c1-35-23-12-13-24(35)19-27(18-23)39-32(37)30-16-17-34(22-8-4-3-5-9-22,31-11-7-6-10-29(30)31)33(38)40-28-20-25-14-15-26(21-28)36(25)2/h3-11,23-28,30H,12-21H2,1-2H3/t23-,24+,25-,26+,27,28,30-,34+/m0/s1
InChI Key GERIGMSHTUAXSI-JGOYBSABSA-N
Purity 95%+
Complexity 922
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 6
Exact Mass 542.31445783
Heavy Atom Count 40
Hydrogen Bond Acceptor Count 6
Hydrogen Bond Donor Count 0
Isomeric SMILES CN1[C@@H]2CC[C@H]1CC(C2)OC(=O)[C@H]3CC[C@](C4=CC=CC=C34)(C5=CC=CC=C5)C(=O)OC6C[C@H]7CC[C@@H](C6)N7C
Monoisotopic Mass 542.31445783
PhysicalState Powder
Rotatable Bond Count 7
Topological Polar Surface Area 59.1 Ų
Custom Q&A

What is the full name of the chemical compound with the CAS number 5878-33-1?

bis(8-methyl-8-azabicyclo[3.2.1]oct-3-yl) 1,2,3,4-tetrahydro-1-phenylnaphthalene-1,4-dicarboxylate

What are some synonyms for the compound bis(8-methyl-8-azabicyclo[3.2.1]oct-3-yl) 1,2,3,4-tetrahydro-1-phenylnaphthalene-1,4-dicarboxylate?

Alpha-Belladonnine, Einecs 227-550-6, 1,4-Naphthalenedicarboxylic acid bis(8-methyl-8-azabicyclo[3.2.1]oct-3-yl) ester

What is the molecular formula of the compound Alpha-Belladonnine?

C34H42N2O4

What is the molecular weight of Alpha-Belladonnine?

542.70828 g/mol

What is the EINECS number of the compound?

2275506

What is the stereochemistry of the compound according to the chemical nomenclature given?

(1R,4S)-rel-

What type of compound is Alpha-Belladonnine?

It is a dicarboxylate ester.

What is the role of the 8-methyl-8-azabicyclo[3.2.1]oct-3-yl group in the structure of Alpha-Belladonnine?

It is a functional group that is part of the ester molecule.

How is Alpha-Belladonnine commonly referred to in chemical literature and research?

It is commonly known as Alpha-Belladonnine.

※ Please kindly note that our products are for research use only.