Alpha-obscurine

Catalog Number	ACM596554-1
CAS Number	596-55-4
Synonyms	3,18-Dihydro-17-methyllycodin-1(2H)-one
Molecular Weight	274.4
InChI	InChI=1S/C17H26N2O/c1-11-8-12-9-15-14(5-6-16(20)18-15)17(10-11)13(12)4-3-7-19(17)2/h11-13H,3-10H2,1-2H3,(H,18,20)/t11-,12+,13-,17-/m1/s1
InChI Key	HXJHQEWSHQXRPH-IPJQOSJUSA-N
Melting Point	283-284 °C
Purity	95%+
Complexity	483
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	4
Exact Mass	274.204513457
Heavy Atom Count	20
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	1
Isomeric SMILES	C[C@@H]1C[C@H]2CC3=C(CCC(=O)N3)[C@@]4(C1)[C@@H]2CCCN4C
Monoisotopic Mass	274.204513457
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	32.3 Ų

Custom Q&A

What is the chemical formula of α-Obscurin?

The chemical formula of α-Obscurin is C17H26N2O.

What is the molecular weight of α-Obscurin?

The molecular weight of α-Obscurin is 274.4.

What is the CAS number of α-Obscurin?

The CAS number of α-Obscurin is 596-55-4.

What is the melting point of α-Obscurin?

The melting point of α-Obscurin is 283-284 °C.

What is the boiling point of α-Obscurin?

The boiling point of α-Obscurin is 471.1±45.0 °C.

What is the density of α-Obscurin?

The density of α-Obscurin is 1.14±0.1 g/cm3.

What is the pka value of α-Obscurin?

The pka value of α-Obscurin is 16.04±0.40.

How is α-Obscurin typically used?

α-Obscurin is a sesquiterpenoid.

What are some synonyms for α-Obscurin?

Some synonyms for α-Obscurin include alpha-Obscurine, Α-OBSCURINE, and (4aR,5S,10bR,12R)-2,3,4,4aβ,5,6,7,10-Octahydro-1,12-dimethyl-1H-5β,10bβ-propano-1,7-phenanthrolin-8(9H)-one.

What solvent is used for the melting point of α-Obscurin?

The solvent used for the melting point of α-Obscurin is methanol (67-56-1).

※ Please kindly note that our products are for research use only.