Alpha-solanin

Catalog Number	ACM20562021-1
CAS Number	20562-02-1
Synonyms	α-Solanine
Molecular Weight	868.1
InChI	InChI=1S/C45H73NO15/c1-19-6-9-27-20(2)31-28(46(27)16-19)15-26-24-8-7-22-14-23(10-12-44(22,4)25(24)11-13-45(26,31)5)57-43-40(61-41-37(54)35(52)32(49)21(3)56-41)39(34(51)30(18-48)59-43)60-42-38(55)36(53)33(50)29(17-47)58-42/h7,19-21,23-43,47-55H,6,8-18H2,1-5H3/t19-,20+,21-,23-,24+,25-,26-,27+,28-,29+,30+,31-,32-,33+,34-,35+,36-,37+,38+,39-,40+,41-,42-,43+,44-,45-/m0/s1
InChI Key	ZGVSETXHNHBTRK-UDJLNJFBSA-N
Melting Point	285 °C
Purity	95%+
Complexity	1590
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	26
Exact Mass	867.49802062
Heavy Atom Count	61
Hydrogen Bond Acceptor Count	16
Hydrogen Bond Donor Count	9
Isomeric SMILES	C[C@H]1CC[C@@H]2[C@H]([C@H]3[C@@H](N2C1)C[C@@H]4[C@@]3(CC[C@H]5[C@H]4CC=C6[C@@]5(CC[C@@H](C6)O[C@H]7[C@@H]([C@H]([C@H]([C@H](O7)CO)O)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O)O[C@H]9[C@@H]([C@@H]([C@H]([C@@H](O9)C)O)O)O)C)C)C
Monoisotopic Mass	867.49802062
PhysicalState	Powder
Rotatable Bond Count	8
Topological Polar Surface Area	241 Ų

Custom Q&A

What is the chemical formula for alpha-Solanine?

The chemical formula for alpha-Solanine is C45H73NO15.

What is the melting point of alpha-Solanine?

The melting point of alpha-Solanine is 285℃.

In which Solanum species is alpha-Solanine present?

Alpha-Solanine is present in several Solanum species including S. nigrum, S. lycopersicum (tomato), and S. tuberosum (potato).

What are the potential benefits of alpha-Solanine?

It has been revealed that alpha-Solanine possesses potential chemotherapeutic action against cancers in organs such as lung, breast, esophagus, prostate, and liver, as well as acute lymphocytic leukemia. It also has potential anti-inflammatory properties.

What are the side effects of consuming excessive alpha-Solanine?

Excessive consumption of alpha-Solanine can lead to convulsions, coma, and even death. Animal studies have shown that alpha-Solanine can damage the reproductive system.

How is alpha-Solanine purified?

Alpha-Solanine can be recrystallized from EtOH, 85% aqueous EtOH, MeOH, or aqueous MeOH as a dihydrate. It has insecticidal properties.

What is the hazard classification of alpha-Solanine?

Alpha-Solanine is classified as a poison.

What are the solubility properties of alpha-Solanine?

Alpha-Solanine is readily soluble in hot EtOH, sparingly soluble in H20, and virtually insoluble in CHCl3 or Et2O.

What is the storage temperature recommended for alpha-Solanine?

The recommended storage temperature for alpha-Solanine is -20°C.

How does alpha-Solanine affect the body when consumed in large doses?

When consumed in large doses, alpha-Solanine can lead to symptoms such as nausea, headache, emesis, gastritis, parenchymatous nephritis, haemoglobinuria, paralysis of the central nervous system, and cardiac arrest.

※ Please kindly note that our products are for research use only.