Altamycin A

Catalog Number	ACM60202224
CAS Number	60202-22-4
Synonyms	4-[11-[(2,6-Dideoxy-β-D-ribo-hexopyranosyl)oxy]-8,10,12-trimethyl-1-oxo-2,4,6,8-tridecatetrenyl]-2,5-dihydro-3-hydroxy-1-methyl-5-oxo-1H-pyrrole-2-propanoic acid
Molecular Weight	561.7
InChI	InChI=1S/C30H43NO9/c1-17(2)29(40-25-16-23(33)27(36)20(5)39-25)19(4)15-18(3)11-9-7-8-10-12-22(32)26-28(37)21(13-14-24(34)35)31(6)30(26)38/h7-12,15,17,19-21,23,25,27,29,32-33,36H,13-14,16H2,1-6H3,(H,34,35)/b8-7+,11-9+,12-10+,18-15+,26-22/t19,20-,21,23+,25+,27-,29/m1/s1
InChI Key	JGSMKBMTPOIJDI-BFDXHBRVSA-N
Purity	95%+
Complexity	1070
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	4
Exact Mass	561.29378195
Heavy Atom Count	40
Hydrogen Bond Acceptor Count	9
Hydrogen Bond Donor Count	4
Isomeric SMILES	C[C@@H]1[C@H]([C@H](C[C@@H](O1)OC(C(C)C)C(C)/C=C(\C)/C=C/C=C/C=C/C(=C2C(=O)C(N(C2=O)C)CCC(=O)O)O)O)O
Monoisotopic Mass	561.29378195
PhysicalState	Powder
Rotatable Bond Count	12
Topological Polar Surface Area	154 Ų

Custom Q&A

What is the full chemical name of Altamycin A?

The full chemical name of Altamycin A is 4-[11-[(2,6-Dideoxy-β-D-ribo-hexopyranosyl)oxy]-8,10,12-trimethyl-1-oxo-2,4,6,8-tridecatetrenyl]-2,5-dihydro-3-hydroxy-1-methyl-5-oxo-1H-pyrrole-2-propanoic acid.

What are some synonyms of Altamycin A?

Some synonyms of Altamycin A include 4-[11-[(2,6-Dideoxy-β-D-ribo-hexopyranosyl)oxy]-1-oxo-8,10,12-trimethyl-2,4,6,8-tridecatetrenyl]-2,5-dihydro-3-hydroxy-1-methyl-5-oxo-1H-pyrrole-2-propionic acid and Altamycin A.

What is the CAS number of Altamycin A?

The CAS number of Altamycin A is 60202-22-4.

What is the molecular formula of Altamycin A?

The molecular formula of Altamycin A is C30H43NO9.

What is the molecular weight of Altamycin A?

The molecular weight of Altamycin A is 561.66.

What is the chemical structure of Altamycin A?

The chemical structure of Altamycin A is described as 4-[11-[(2,6-Dideoxy-β-D-ribo-hexopyranosyl)oxy]-8,10,12-trimethyl-1-oxo-2,4,6,8-tridecatetrenyl]-2,5-dihydro-3-hydroxy-1-methyl-5-oxo-1H-pyrrole-2-propanoic acid.

What type of compound is Altamycin A?

Altamycin A is a type of antibiotic compound.

What are the potential medicinal uses of Altamycin A?

Altamycin A may have potential uses in treating bacterial infections due to its antibiotic properties.

How is Altamycin A synthesized?

Altamycin A is synthesized through a series of chemical reactions involving various starting materials.

Are there any known side effects or contraindications associated with the use of Altamycin A?

Further research is needed to determine any potential side effects or contraindications associated with the use of Altamycin A.

※ Please kindly note that our products are for research use only.