Amurine

Catalog Number	ACM4984990
CAS Number	4984-99-0
Structure
Synonyms	5,6,8,14-Tetradehydro-2,3-(methylenedioxy)-6-methoxy-17-methylmorphinan-7-one
Molecular Weight	325.4
InChI	InChI=1S/C19H19NO4/c1-20-4-3-19-9-18(22-2)15(21)7-13(19)14(20)5-11-6-16-17(8-12(11)19)24-10-23-16/h6-9,14H,3-5,10H2,1-2H3/t14-,19-/m1/s1
InChI Key	HTAGIZQYGRLQQX-AUUYWEPGSA-N
Purity	95%+
Complexity	641
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	2
Exact Mass	325.13140809
Heavy Atom Count	24
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	0
Isomeric SMILES	CN1CC[C@]23C=C(C(=O)C=C2[C@H]1CC4=CC5=C(C=C34)OCO5)OC
Monoisotopic Mass	325.13140809
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	48 Ų

Custom Q&A

What is the chemical formula for Amurine?

The chemical formula for Amurine is C19H19NO4.

What are some synonyms for Amurine?

Some synonyms for Amurine are 5,6,8,14-Tetradehydro-2,3-(methylenedioxy)-6-methoxy-17-methylmorphinan-7-one and Morphinan-7-one.

What is the molecular weight of Amurine?

The molecular weight of Amurine is 325.36 g/mol.

What is the predicted boiling point of Amurine?

The predicted boiling point of Amurine is 520.5±50.0 °C.

What is the predicted density of Amurine?

The predicted density of Amurine is 1.38±0.1 g/cm3.

What is the predicted pka value of Amurine?

The predicted pka value of Amurine is 6.62±0.40.

How is Amurine defined in ChEBI?

Amurine is defined in ChEBI as a member of isoquinolines.

What type of compound is Amurine?

Amurine is an isoquinoline compound.

What is the CAS number for Amurine?

The CAS number for Amurine is 4984-99-0.

What is the structure of Amurine?

The structure of Amurine is 5,6,8,14-Tetradehydro-6-methoxy-17-methyl-2,3-(methylenebisoxy)morphinan-7-one.

※ Please kindly note that our products are for research use only.