Angoline

Catalog Number	ACM21080319
CAS Number	21080-31-9
Synonyms	6-Methoxyldihydrochelerythrine
IUPAC Name	1,2,13-Trimethoxy-12-methyl-13H-[1,3]benzodioxolo[5,6-c]phenanthridine
Molecular Weight	379.41
Molecular Formula	C22H21NO5
Canonical SMILES	CN1C(C2=C(C=CC(=C2OC)OC)C3=C1C4=CC5=C(C=C4C=C3)OCO5)OC
InChI	InChI=1S/C22H21NO5/c1-23-20-14(6-5-12-9-17-18(10-15(12)20)28-11-27-17)13-7-8-16(24-2)21(25-3)19(13)22(23)26-4/h5-10,22H,11H2,1-4H3
InChI Key	LVWAKZBZWYHYCJ-UHFFFAOYSA-N
Purity	98%+
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	561
Exact Mass	379.14197277
Heavy Atom Count	28
Monoisotopic Mass	379.14197277
Topological Polar Surface Area	49.4Ų

Custom Q&A

What is the chemical name of angoline?

The chemical name of "angoline" is 12,13-Dihydro-1,2,13-trimethoxy-12-methyl[1,3]benzodioxolo[5,6-c]phenanthridine.

What are some synonyms for angoline?

Some synonyms for "angoline" include 6-Methoxyldihydrochelerythrine and phosphorylation, proliferation, STAT3, anticancer, inhibit, Angoline, Inhibitor, STAT, IL-6.

What is the CAS number of angoline?

The CAS number of "angoline" is 21080-31-9.

What is the molecular formula of angoline?

The molecular formula of "angoline" is C22H21NO5.

What is the molecular weight of angoline?

The molecular weight of "angoline" is 379.41.

What is the recommended storage temperature for angoline?

The recommended storage temperature for angoline is 4°C, and it should be protected from light.

What is the empirical formula of the angoline alkaloid?

The empirical formula of the angoline alkaloid should read C21H21NO5.

What is the ChEBI definition of angoline?

The ChEBI definition of angoline is that it is a benzophenanthridine alkaloid.

What are some potential uses of angoline?

Angoline is associated with terms such as phosphorylation, proliferation, STAT3, anticancer, and inhibition, indicating potential uses in cancer research and treatment.

How does angoline affect STAT and IL-6?

Angoline is an inhibitor of STAT and IL-6, suggesting its potential role in regulating these signaling pathways.

※ Please kindly note that our products are for research use only.