Angustine

Angustine

Inquiry
Catalog Number ACM40041961
CAS Number 40041-96-1
Structure
Synonyms 1-Vinyl-8,13-dihydroindolo[2',3':3,4]pyrido[1,2-b][2,7]naphthyridin-5(7H)-one
Molecular Weight 313.4
InChI InChI=1S/C20H15N3O/c1-2-12-10-21-11-16-15(12)9-18-19-14(7-8-23(18)20(16)24)13-5-3-4-6-17(13)22-19/h2-6,9-11,22H,1,7-8H2
InChI Key FACXQEOSOVJIPD-UHFFFAOYSA-N
Purity 95%+
Complexity 585
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 313.12151211
Heavy Atom Count 24
Hydrogen Bond Acceptor Count 2
Hydrogen Bond Donor Count 1
Monoisotopic Mass 313.12151211
PhysicalState Powder
Rotatable Bond Count 1
Topological Polar Surface Area 49 Ų
Custom Q&A

What is the product name of Angustine?

The product name of Angustine is Angustine.

What are some synonyms for Angustine?

Some synonyms for Angustine are 1-Vinyl-8,13-dihydroindolo[2',3':3,4]pyrido[1,2-b][2,7]naphthyridin-5(7H)-one and Indolo[2',3':3,4]pyrido[1,2-b][2,7]naphthyridin-5(7H)-one, 1-ethenyl-8,13-dihydro-.

What is the CAS number of Angustine?

The CAS number of Angustine is 40041-96-1.

What is the molecular formula of Angustine?

The molecular formula of Angustine is C20H15N3O.

What is the molecular weight of Angustine?

The molecular weight of Angustine is 313.35.

What is the melting point of Angustine?

The melting point of Angustine is greater than 350°C.

What is the boiling point of Angustine?

The boiling point of Angustine is predicted to be 648.2±55.0°C.

What is the density of Angustine?

The density of Angustine is predicted to be 1.40±0.1 g/cm3.

How is Angustine synthesized?

Angustine is synthesized through the condensation of ethyl oxalate with 4-methyl-5-vinylinicotinonitrile, followed by condensation of the lactone produced with tryptamine. Hydrolysis and cyclization of the product yield Angustine.

What is Angustine classified as in terms of chemical structure?

Angustine is classified as a member of beta-carbolines.

※ Please kindly note that our products are for research use only.