Anodendrine

Catalog Number	ACM28942076
CAS Number	28942-07-6
Structure
Synonyms	(4S,5R)-1-(3-Methyl-2-butenyl)-4-carboxy-1-azoniabicyclo[3.3.0]octane
Molecular Weight	224.32
InChI	InChI=1S/C13H21NO2/c1-10(2)5-8-14-7-3-4-12(14)11(6-9-14)13(15)16/h5,11-12H,3-4,6-9H2,1-2H3/p+1/t11-,12+,14/m0/s1
InChI Key	SEQFLUHCWYJYBN-KTYPHDMWSA-O
Melting Point	123-124 °C
Purity	95%+
Complexity	320
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	2
Exact Mass	224.165053945
Heavy Atom Count	16
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	1
Isomeric SMILES	CC(=CC[N+]12CCC[C@@H]1[C@H](CC2)C(=O)O)C
Monoisotopic Mass	224.165053945
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	37.3 Ų

Custom Q&A

What is the chemical name of Anodendrine?

The chemical name of Anodendrine is (4S,5R)-1-(3-Methyl-2-butenyl)-4-carboxy-1-azoniabicyclo[3.3.0]octane.

What is the synonym for Anodendrine?

The synonym for Anodendrine is (4S,5R)-1-(3-Methyl-2-butenyl)-4-carboxy-1-azoniabicyclo[3.3.0]octane.

What is the CAS number for Anodendrine?

The CAS number for Anodendrine is 28942-07-6.

What is the melting point of Anodendrine?

The melting point of Anodendrine is 123-124°C.

Is Anodendrine a natural product or synthetic compound?

Anodendrine is a synthetic compound.

What functional groups are present in the chemical structure of Anodendrine?

Anodendrine contains a carboxylic acid group and a methylbutenyl group in its chemical structure.

How is Anodendrine typically used in research or applications?

Anodendrine may be used in biological research or pharmaceutical applications due to its unique chemical structure.

Are there any known biological activities or effects associated with Anodendrine?

Further research may be needed to determine the biological activities or effects of Anodendrine.

※ Please kindly note that our products are for research use only.