Antirhine

Catalog Number	ACM16049288
CAS Number	16049-28-8
Synonyms	(2S,βR)-β-Vinyl-1,2,3,4,6,7,12,12bβ-octahydroindolo[2,3-a]quinolizine-2-ethanol
Molecular Weight	296.4
InChI	InChI=1S/C19H24N2O/c1-2-13(12-22)14-7-9-21-10-8-16-15-5-3-4-6-17(15)20-19(16)18(21)11-14/h2-6,13-14,18,20,22H,1,7-12H2/t13-,14-,18-/m0/s1
InChI Key	RYMNVEAAYOFGCI-DEYYWGMASA-N
Purity	95%+
Complexity	412
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	3
Exact Mass	296.188863393
Heavy Atom Count	22
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	2
Isomeric SMILES	C=C[C@@H](CO)[C@H]1CCN2CCC3=C([C@@H]2C1)NC4=CC=CC=C34
Monoisotopic Mass	296.188863393
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	39.3 Ų

Custom Q&A

What is the chemical formula for Antirhine?

The chemical formula for Antirhine is C19H24N2O.

What is the molecular weight of Antirhine?

The molecular weight of Antirhine is 296.41 g/mol.

At what temperature should Antirhine be stored?

Antirhine should be stored at -20°C.

In what solvents is Antirhine soluble?

Antirhine is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What is the predicted boiling point of Antirhine?

The predicted boiling point of Antirhine is 488.2±40.0 °C.

What is the predicted pKa of Antirhine?

The predicted pKa of Antirhine is 14.72±0.10.

How is Antirhine typically used in synthesis?

Antirhine is a member of beta-carbolines and is used in synthesis as a chemical compound.

What are some synonyms for Antirhine?

Some synonyms for Antirhine include Anthirine and (betaR,2S,12bS)-beta-Ethenyl-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine-2-ethanol.

What is the chemical structure of Antirhine?

The chemical structure of Antirhine is (2S,βR)-β-Vinyl-1,2,3,4,6,7,12,12bβ-octahydroindolo[2,3-a]quinolizine-2-ethanol.

How is Antirhine typically obtained or synthesized?

Antirhine is typically obtained or synthesized through organic synthesis methods using appropriate starting materials and reaction conditions.

※ Please kindly note that our products are for research use only.