Apiodionene

Catalog Number	ACM142808386
CAS Number	142808-38-6
Synonyms	2,4-Pyrrolidinedione, 3-[5,6-dihydro-5-methyl-6-(1-propenyl)-2H-pyran-2-ylidene]- (9CI)
Molecular Weight	233.26
InChI	POOATOCXPUJODS-XLIZWXFJSA-N
InChI Key	CC=CC1C(C=CC(=C2C(=O)CNC2=O)O1)C
Purity	95%+
Complexity	446
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	2
Exact Mass	233.10519334
Heavy Atom Count	17
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	1
Monoisotopic Mass	233.10519334
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	55.4 Ų

Custom Q&A

What is the product name of Apiodionene?

The product name of Apiodionene is Apiodionene.

What are some synonyms for Apiodionene?

Some synonyms for Apiodionene are 2,4-Pyrrolidinedione, 3-[5,6-dihydro-5-methyl-6-(1-propenyl)-2H-pyran-2-ylidene]- (9CI).

What is the CAS number for Apiodionene?

The CAS number for Apiodionene is 142808-38-6.

What is the molecular formula of Apiodionene?

The molecular formula of Apiodionene is C13H15NO3.

What is the molecular weight of Apiodionene?

The molecular weight of Apiodionene is 233.26.

What is the chemical structure of Apiodionene?

The chemical structure of Apiodionene is 2,4-Pyrrolidinedione, 3-[5,6-dihydro-5-methyl-6-(1-propenyl)-2H-pyran-2-ylidene].

How is Apiodionene commonly used in industries?

Apiodionene is commonly used in industries as a chemical compound in various applications.

Can you explain the significance of the 9CI in the synonym of Apiodionene?

The 9CI in the synonym of Apiodionene refers to the Chemical Abstracts Service (CAS) Index name, which is a unique identifier for chemical substances.

※ Please kindly note that our products are for research use only.