Aponorhyoscine

Catalog Number	ACM25650560
CAS Number	25650-56-0
Structure
Synonyms	Benzeneacetic acid, α-methylene-, (1α,2β,4β,5α,7β)-3-oxa-9-azatricyclo[3.3.1.02,4]non-7-yl ester
Molecular Weight	271.31
InChI	InChI=1S/C16H17NO3/c1-9(10-5-3-2-4-6-10)16(18)19-11-7-12-14-15(20-14)13(8-11)17-12/h2-6,11-15,17H,1,7-8H2
InChI Key	UPWMWFSEBOFTNA-UHFFFAOYSA-N
Purity	95%+
Complexity	413
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	271.1208434
Heavy Atom Count	20
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	1
Monoisotopic Mass	271.1208434
PhysicalState	Powder
Rotatable Bond Count	4
Topological Polar Surface Area	50.9 Ų

Custom Q&A

What is the chemical formula for Aponorhyoscine?

The chemical formula for Aponorhyoscine is C16H17NO3.

What is the molecular weight of Aponorhyoscine?

The molecular weight of Aponorhyoscine is 271.31.

What is the CAS number for Aponorhyoscine?

The CAS number for Aponorhyoscine is 25650-56-0.

What plant contains Aponorhyoscine?

The roots of Anthoceris genistoides contain Aponorhyoscine.

What are some synonyms for Aponorhyoscine?

Some synonyms for Aponorhyoscine include Benzeneacetic acid, α-methylene-, (1α,2β,4β,5α,7β)-3-oxa-9-azatricyclo[3.3.1.02,4]non-7-yl ester.

What is the basic information of Aponorhyoscine?

The basic information of Aponorhyoscine includes its chemical formula, molecular weight, CAS number, and synonyms.

How is Aponorhyoscine classified chemically?

Aponorhyoscine is classified as a tropane ester alkaloid.

What is the primary use of Aponorhyoscine?

Aponorhyoscine is primarily used for medicinal purposes.

Can Aponorhyoscine be found in any other plants?

In addition to Anthoceris genistoides, Aponorhyoscine can also be found in other plants in the same family.

What is the structure of Aponorhyoscine?

The structure of Aponorhyoscine is composed of a benzeneacetic acid group linked to a tropane ester alkaloid.

※ Please kindly note that our products are for research use only.