Aporeine

Catalog Number	ACM2030537
CAS Number	2030-53-7
Structure
Synonyms	S-(+)-Roemerine
Molecular Weight	279.3
InChI	InChI=1S/C18H17NO2/c1-19-7-6-12-9-15-18(21-10-20-15)17-13-5-3-2-4-11(13)8-14(19)16(12)17/h2-5,9,14H,6-8,10H2,1H3/t14-/m0/s1
InChI Key	JCTYWRARKVGOBK-AWEZNQCLSA-N
Melting Point	102 °C
Purity	95%+
Complexity	414
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	1
Exact Mass	279.125928785
Heavy Atom Count	21
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	0
Isomeric SMILES	CN1CCC2=CC3=C(C4=C2[C@@H]1CC5=CC=CC=C54)OCO3
Monoisotopic Mass	279.125928785
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	21.7 Ų

Custom Q&A

What is the chemical formula of [7aS,(+)]-6,7,7a,8-Tetrahydro-7-methyl-5H-benzo[g]-1,3-benzodioxolo[6,5,4-de]quinoline?

The chemical formula is C18H17NO2.

What is the molecular weight of [7aS,(+)]-6,7,7a,8-Tetrahydro-7-methyl-5H-benzo[g]-1,3-benzodioxolo[6,5,4-de]quinoline?

The molecular weight is 279.33.

What is the CAS number of [7aS,(+)]-6,7,7a,8-Tetrahydro-7-methyl-5H-benzo[g]-1,3-benzodioxolo[6,5,4-de]quinoline?

The CAS number is 2030-53-7.

What is the melting point of [7aS,(+)]-6,7,7a,8-Tetrahydro-7-methyl-5H-benzo[g]-1,3-benzodioxolo[6,5,4-de]quinoline?

The melting point is 102°.

What is the specific rotation of [7aS,(+)]-6,7,7a,8-Tetrahydro-7-methyl-5H-benzo[g]-1,3-benzodioxolo[6,5,4-de]quinoline in ethanol?

The specific rotation in ethanol is +80°.

What is the predicted boiling point of [7aS,(+)]-6,7,7a,8-Tetrahydro-7-methyl-5H-benzo[g]-1,3-benzodioxolo[6,5,4-de]quinoline?

The predicted boiling point is 424.0±34.0 °C.

What is the predicted density of [7aS,(+)]-6,7,7a,8-Tetrahydro-7-methyl-5H-benzo[g]-1,3-benzodioxolo[6,5,4-de]quinoline?

The predicted density is 1.269±0.06 g/cm3.

What is the pKa of [7aS,(+)]-6,7,7a,8-Tetrahydro-7-methyl-5H-benzo[g]-1,3-benzodioxolo[6,5,4-de]quinoline at 25℃?

The pKa is 6.1 at 25℃.

What are some uses of Aporrheine?

Aporrheine can be used for topical delivery against skin cancer and has cardioprotective potential on doxorubicin induced cardiotoxicity in rats. It can also be used for treating various infections.

How can Aporrheine be used in medicinal applications?

Aporrheine can be used in the form of alkaloid and terpenoid compounds isolated from natural sources to treat various infections.

※ Please kindly note that our products are for research use only.