Aricine

Catalog Number	ACM482917
CAS Number	482-91-7
Synonyms	Heterophylline
Molecular Weight	382.5
InChI	InChI=1S/C22H26N2O4/c1-12-17-10-24-7-6-14-16-8-13(26-2)4-5-19(16)23-21(14)20(24)9-15(17)18(11-28-12)22(25)27-3/h4-5,8,11-12,15,17,20,23H,6-7,9-10H2,1-3H3/t12-,15-,17-,20-/m0/s1
InChI Key	DTDADHMBRZKXSC-GKASHWOUSA-N
Purity	95%+
Complexity	652
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	4
Exact Mass	382.18925731
Heavy Atom Count	28
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	1
Isomeric SMILES	C[C@H]1[C@@H]2CN3CCC4=C([C@@H]3C[C@@H]2C(=CO1)C(=O)OC)NC5=C4C=C(C=C5)OC
Monoisotopic Mass	382.18925731
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	63.8 Ų

Custom Q&A

What are some synonyms for ARICINE?

CINCHOVATIN, HETEROPHYLLIN, Heterophylline, Aricin, Aricine (8ci)

What is the CAS number for ARICINE?

482-91-7

What is the chemical formula of ARICINE?

C22H26N2O4

What is the molecular weight of ARICINE?

382.45

In what form is ARICINE commonly found?

Powder

What is the solubility of ARICINE?

Soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What is the pKa of ARICINE in 80% methyl cellosolve?

5.80

In what occurrence can ARICINE be found in nature?

It occurs in both Parsonia heterophylla A. Cun. and P. spiralis Wall.

What kind of alkaloid is ARICINE?

A yohimban alkaloid

What is the chemical structure of ARICINE?

(20α)-16,17-Didehydro-10-methoxy-19α-methyl-18-oxayohimban-16-carboxylic acid methyl ester

※ Please kindly note that our products are for research use only.