Aristolactam AIa

Catalog Number	ACM97399901
CAS Number	97399-90-1
Structure
Synonyms	2,7-Dihydroxy-1-methoxydibenz[cd,f]indol-4(5H)-one
Molecular Weight	281.26
InChI	InChI=1S/C16H11NO4/c1-21-15-12(19)6-9-13-10(17-16(9)20)5-8-7(14(13)15)3-2-4-11(8)18/h2-6,18-19H,1H3,(H,17,20)
InChI Key	WUNSWKSWDUMDTB-UHFFFAOYSA-N
Purity	95%+
Complexity	442
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	281.06880783
Heavy Atom Count	21
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	3
Monoisotopic Mass	281.06880783
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	78.8 Ų

Custom Q&A

What is the product name of AristolactaM AIa?

The product name is AristolactaM AIa.

What are some synonyms for AristolactaM AIa?

Some synonyms are 2,7-Dihydroxy-1-methoxydibenz[cd,f]indol-4(5H)-one and Aristololactam A Ia.

What is the PubChem ID of AristolactaM AIa?

The PubChem ID is 86129027.

What is the chemical formula of AristolactaM AIa?

The chemical formula is C16H11NO4.

What is the molecular weight of AristolactaM AIa?

The molecular weight is 281.26.

What is the predicted boiling point of AristolactaM AIa?

The predicted boiling point is 521.1±50.0 °C.

In what solvents is AristolactaM AIa soluble?

It is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, and Acetone.

What is the predicted pka of AristolactaM AIa?

The predicted pka is 8.63±0.20.

What is the color of AristolactaM AIa?

The color is yellow.

What is the physical form of AristolactaM AIa?

It is in powder form.

※ Please kindly note that our products are for research use only.