Arundanine

Catalog Number	ACM618852714
CAS Number	618852-71-4
IUPAC Name	3-[2-(Dimethylamino)ethyl]-4-[3-[2-(dimethylamino)ethyl]indol-1-yl]-1H-indol-5-ol
Molecular Weight	390.52
Molecular Formula	C24H30N4O
Canonical SMILES	CN(C)CCC1=CNC2=C1C(=C(C=C2)O)N3C=C(C4=CC=CC=C43)CCN(C)C
InChI	InChI=1S/C24H30N4O/c1-26(2)13-11-17-15-25-20-9-10-22(29)24(23(17)20)28-16-18(12-14-27(3)4)19-7-5-6-8-21(19)28/h5-10,15-16,25,29H,11-14H2,1-4H3
InChI Key	CMWJUTZFSDKTAV-UHFFFAOYSA-N
Purity	98%+ (HPLC)
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	527
Exact Mass	390.24196159
Heavy Atom Count	29
Monoisotopic Mass	390.24196159
Topological Polar Surface Area	47.4Ų

Custom Q&A

What is the chemical name of Arundanine?

The chemical name of Arundanine is [1,4'-Bi-1H-indol]-5'-ol, 3,3'-bis[2-(dimethylamino)ethyl].

What is the CAS number of Arundanine?

The CAS number of Arundanine is 618852-71-4.

What is the molecular formula of Arundanine?

The molecular formula of Arundanine is C24H30N4O.

What is the molecular weight of Arundanine?

The molecular weight of Arundanine is 390.52.

What is the melting point of Arundanine?

The melting point of Arundanine is 198-199°C.

What is the predicted boiling point of Arundanine?

The predicted boiling point of Arundanine is 593.0±50.0°C.

What is the predicted density of Arundanine?

The predicted density of Arundanine is 1.16±0.1 g/cm3.

What is the predicted pKa value of Arundanine?

The predicted pKa value of Arundanine is 8.94±0.50.

※ Please kindly note that our products are for research use only.