Aspertine C

Catalog Number	ACM442155626
CAS Number	442155-62-6
Molecular Weight	257.41
InChI	InChI=1S/C15H31NO2/c1-3-6-14(17)10-12-8-5-9-13(16-12)11-15(18)7-4-2/h12-18H,3-11H2,1-2H3/t12-,13-,14-,15-/m0/s1
InChI Key	YASYAQIAFYRYBX-AJNGGQMLSA-N
Purity	95%+
Complexity	191
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	4
Exact Mass	257.235479232
Heavy Atom Count	18
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	3
Isomeric SMILES	CCC[C@@H](C[C@@H]1CCC[C@H](N1)C[C@H](CCC)O)O
Monoisotopic Mass	257.235479232
PhysicalState	Powder
Rotatable Bond Count	8
Topological Polar Surface Area	52.5 Ų

Custom Q&A

What is the product name of the chemical compound with CAS number 442155-62-6?

The product name is Aspertine C.

What are some synonyms for Aspertine C?

Some synonyms for Aspertine C are 2,6-Piperidinediethanol, α2,α6-dipropyl-, (2S,α2S,6S,α6S)-.

What is the molecular formula of Aspertine C?

The molecular formula is C15H31NO2.

What is the molecular weight of Aspertine C?

The molecular weight is 257.42.

What is the boiling point of Aspertine C?

The boiling point is predicted to be 401.2±20.0 °C.

What is the density of Aspertine C?

The density is predicted to be 0.944±0.06 g/cm3.

What is the pKa value of Aspertine C?

The pKa value is predicted to be 14.92±0.20.

※ Please kindly note that our products are for research use only.